C42H26N4O — CID 159089433
12-(4,6-diphenyl-1,3,5-triazin-2-yl)-15-(4-phenylphenyl)-17-oxa-13-azatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12,14-octaene (PubChem CID 159089433) has the molecular formula C42H26N4O and a molecular weight of 602.70 g/mol. Its IUPAC name is 12-(4,6-diphenyl-1,3,5-triazin-2-yl)-15-(4-phenylphenyl)-17-oxa-13-azatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12,14-octaene.
| Compound Name | 12-(4,6-diphenyl-1,3,5-triazin-2-yl)-15-(4-phenylphenyl)-17-oxa-13-azatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12,14-octaene |
|---|---|
| PubChem CID | 159089433 |
| Molecular Formula | C42H26N4O |
| Molecular Weight | 602.70 g/mol |
| Exact Mass | 602.21 |
| IUPAC Name | 12-(4,6-diphenyl-1,3,5-triazin-2-yl)-15-(4-phenylphenyl)-17-oxa-13-azatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12,14-octaene |
| SMILES | c1ccc(-c2ccc(-c3cnc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c4c3oc3cc5ccccc5cc34)cc2)cc1 |
| InChI | InChI=1S/C42H26N4O/c1-4-12-27(13-5-1)28-20-22-29(23-21-28)35-26-43-38(37-34-24-32-18-10-11-19-33(32)25-36(34)47-39(35)37)42-45-40(30-14-6-2-7-15-30)44-41(46-42)31-16-8-3-9-17-31/h1-26H |
| InChIKey | KBWFBMWUFHERKU-UHFFFAOYSA-N |
| XLogP | 10.65 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.70 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |