C13H15NO7Y-2 — CID 159089531
ethanone;(6-methoxy-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-id-5-yl) acetate;yttrium (PubChem CID 159089531) has the molecular formula C13H15NO7Y-2 and a molecular weight of 386.17 g/mol. Its IUPAC name is ethanone;(6-methoxy-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-id-5-yl) acetate;yttrium.
| Compound Name | ethanone;(6-methoxy-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-id-5-yl) acetate;yttrium |
|---|---|
| PubChem CID | 159089531 |
| Molecular Formula | C13H15NO7Y-2 |
| Molecular Weight | 386.17 g/mol |
| Exact Mass | 385.99 |
| IUPAC Name | ethanone;(6-methoxy-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-id-5-yl) acetate;yttrium |
| SMILES | COC1C(OC(C)=O)C2OC1C1C(=O)[N-]C(=O)C21.C[C-]=O.[Y] |
| InChI | InChI=1S/C11H13NO6.C2H3O.Y/c1-3(13)17-9-7-5-4(10(14)12-11(5)15)6(18-7)8(9)16-2;1-2-3;/h4-9H,1-2H3,(H,12,14,15);1H3;/q;-1;/p-1 |
| InChIKey | MDGGXKKMQPCNPR-UHFFFAOYSA-M |
| XLogP | -0.50 |
| TPSA | 110.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.17 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|