C36H60O6 — CID 159089537
2-[(1R)-1,5,5-trimethylcyclopent-2-en-1-yl]ethyl acetate;2-[(1S)-1,5,5-trimethylcyclopent-2-en-1-yl]ethyl acetate;2-(1,5,5-trimethylcyclopent-2-en-1-yl)ethyl acetate (PubChem CID 159089537) has the molecular formula C36H60O6 and a molecular weight of 588.87 g/mol. Its IUPAC name is 2-[(1R)-1,5,5-trimethylcyclopent-2-en-1-yl]ethyl acetate;2-[(1S)-1,5,5-trimethylcyclopent-2-en-1-yl]ethyl acetate;2-(1,5,5-trimethylcyclopent-2-en-1-yl)ethyl acetate.
| Compound Name | 2-[(1R)-1,5,5-trimethylcyclopent-2-en-1-yl]ethyl acetate;2-[(1S)-1,5,5-trimethylcyclopent-2-en-1-yl]ethyl acetate;2-(1,5,5-trimethylcyclopent-2-en-1-yl)ethyl acetate |
|---|---|
| PubChem CID | 159089537 |
| Molecular Formula | C36H60O6 |
| Molecular Weight | 588.87 g/mol |
| Exact Mass | 588.44 |
| IUPAC Name | 2-[(1R)-1,5,5-trimethylcyclopent-2-en-1-yl]ethyl acetate;2-[(1S)-1,5,5-trimethylcyclopent-2-en-1-yl]ethyl acetate;2-(1,5,5-trimethylcyclopent-2-en-1-yl)ethyl acetate |
| SMILES | CC(=O)OCCC1(C)C=CCC1(C)C.CC(=O)OCC[C@@]1(C)C=CCC1(C)C.CC(=O)OCC[C@]1(C)C=CCC1(C)C |
| InChI | InChI=1S/3C12H20O2/c3*1-10(13)14-9-8-12(4)7-5-6-11(12,2)3/h3*5,7H,6,8-9H2,1-4H3/t2*12-;/m10./s1 |
| InChIKey | KBWNYSIAXMBMGI-GPFGRTHNSA-N |
| XLogP | 8.80 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.87 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|