C23H31ClNOY+ — CID 159089849
1-benzyl-1-[2-(2-chloro-6-methylphenoxy)ethyl]azocan-1-ium;yttrium (PubChem CID 159089849) has the molecular formula C23H31ClNOY+ and a molecular weight of 461.87 g/mol. Its IUPAC name is 1-benzyl-1-[2-(2-chloro-6-methylphenoxy)ethyl]azocan-1-ium;yttrium.
| Compound Name | 1-benzyl-1-[2-(2-chloro-6-methylphenoxy)ethyl]azocan-1-ium;yttrium |
|---|---|
| PubChem CID | 159089849 |
| Molecular Formula | C23H31ClNOY+ |
| Molecular Weight | 461.87 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | 1-benzyl-1-[2-(2-chloro-6-methylphenoxy)ethyl]azocan-1-ium;yttrium |
| SMILES | Cc1cccc(Cl)c1OCC[N+]1(Cc2ccccc2)CCCCCCC1.[Y] |
| InChI | InChI=1S/C23H31ClNO.Y/c1-20-11-10-14-22(24)23(20)26-18-17-25(15-8-3-2-4-9-16-25)19-21-12-6-5-7-13-21;/h5-7,10-14H,2-4,8-9,15-19H2,1H3;/q+1; |
| InChIKey | FOSFPQXFZZTSIO-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.87 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|