About trimethylazanium;chloride;hydroiodide
trimethylazanium;chloride;hydroiodide (PubChem CID 159092096) has the molecular formula C3H11ClIN
and a molecular weight of 223.49 g/mol. Its IUPAC name is trimethylazanium;chloride;hydroiodide.
Molecular Properties
| Compound Name | trimethylazanium;chloride;hydroiodide |
| PubChem CID | 159092096 |
| Molecular Formula | C3H11ClIN |
| Molecular Weight | 223.49 g/mol |
| Exact Mass | 222.96 |
| IUPAC Name | trimethylazanium;chloride;hydroiodide |
| SMILES | C[NH+](C)C.I.[Cl-] |
| InChI | InChI=1S/C3H9N.ClH.HI/c1-4(2)3;;/h1-3H3;2*1H |
| InChIKey | HAGVQDXSAUJFJT-UHFFFAOYSA-N |
| XLogP | -3.62 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.49 |
| LogP ≤ 5 | -3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze trimethylazanium;chloride;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethylazanium;chloride;hydroiodide?
The IUPAC name of trimethylazanium;chloride;hydroiodide (CID 159092096) is trimethylazanium;chloride;hydroiodide.
What is the SMILES notation for trimethylazanium;chloride;hydroiodide?
The canonical SMILES for trimethylazanium;chloride;hydroiodide is C[NH+](C)C.I.[Cl-].
What is the InChIKey of trimethylazanium;chloride;hydroiodide?
The InChIKey is HAGVQDXSAUJFJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N.ClH.HI/c1-4(2)3;;/h1-3H3;2*1H.
What are the key properties of trimethylazanium;chloride;hydroiodide?
trimethylazanium;chloride;hydroiodide has a molecular weight of 223.49 g/mol, XLogP of -3.62, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trimethylazanium;chloride;hydroiodide is sourced from PubChem (CID 159092096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).