C38H19N3OS — CID 159092725
9-(9-dibenzothiophen-1-yl-6-isocyanodibenzofuran-4-yl)carbazole-2-carbonitrile (PubChem CID 159092725) has the molecular formula C38H19N3OS and a molecular weight of 565.66 g/mol. Its IUPAC name is 9-(9-dibenzothiophen-1-yl-6-isocyanodibenzofuran-4-yl)carbazole-2-carbonitrile.
| Compound Name | 9-(9-dibenzothiophen-1-yl-6-isocyanodibenzofuran-4-yl)carbazole-2-carbonitrile |
|---|---|
| PubChem CID | 159092725 |
| Molecular Formula | C38H19N3OS |
| Molecular Weight | 565.66 g/mol |
| Exact Mass | 565.12 |
| IUPAC Name | 9-(9-dibenzothiophen-1-yl-6-isocyanodibenzofuran-4-yl)carbazole-2-carbonitrile |
| SMILES | [C-]#[N+]c1ccc(-c2cccc3sc4ccccc4c23)c2c1oc1c(-n3c4ccccc4c4ccc(C#N)cc43)cccc12 |
| InChI | InChI=1S/C38H19N3OS/c1-40-29-19-18-26(25-10-7-15-34-35(25)27-9-3-5-14-33(27)43-34)36-28-11-6-13-31(37(28)42-38(29)36)41-30-12-4-2-8-23(30)24-17-16-22(21-39)20-32(24)41/h2-20H |
| InChIKey | AFKFRJNRGWLNKY-UHFFFAOYSA-N |
| XLogP | 11.14 |
| TPSA | 46.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.66 |
| LogP ≤ 5 | 11.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|