C26H27F4N5O5 — CID 159095535
4-(3,4-difluorophenyl)-N,5-dimethyl-2-oxo-1,3-oxazolidine-3-carboxamide;4-(3,4-difluorophenyl)-N,5,6-trimethyl-2-oxo-1,4-dihydropyrimidine-3-carboxamide (PubChem CID 159095535) has the molecular formula C26H27F4N5O5 and a molecular weight of 565.52 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)-N,5-dimethyl-2-oxo-1,3-oxazolidine-3-carboxamide;4-(3,4-difluorophenyl)-N,5,6-trimethyl-2-oxo-1,4-dihydropyrimidine-3-carboxamide.
| Compound Name | 4-(3,4-difluorophenyl)-N,5-dimethyl-2-oxo-1,3-oxazolidine-3-carboxamide;4-(3,4-difluorophenyl)-N,5,6-trimethyl-2-oxo-1,4-dihydropyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 159095535 |
| Molecular Formula | C26H27F4N5O5 |
| Molecular Weight | 565.52 g/mol |
| Exact Mass | 565.19 |
| IUPAC Name | 4-(3,4-difluorophenyl)-N,5-dimethyl-2-oxo-1,3-oxazolidine-3-carboxamide;4-(3,4-difluorophenyl)-N,5,6-trimethyl-2-oxo-1,4-dihydropyrimidine-3-carboxamide |
| SMILES | CNC(=O)N1C(=O)NC(C)=C(C)C1c1ccc(F)c(F)c1.CNC(=O)N1C(=O)OC(C)C1c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H15F2N3O2.C12H12F2N2O3/c1-7-8(2)18-14(21)19(13(20)17-3)12(7)9-4-5-10(15)11(16)6-9;1-6-10(7-3-4-8(13)9(14)5-7)16(11(17)15-2)12(18)19-6/h4-6,12H,1-3H3,(H,17,20)(H,18,21);3-6,10H,1-2H3,(H,15,17) |
| InChIKey | KCPRZRKHKKJMNQ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.52 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |