C15H24N2O3 — CID 159095862
methyl 2-[(3aR,6R,8aS)-6-(2-methylpropyl)-8-oxo-1,2,3,3a,6,8a-hexahydropyrrolo[2,3-c]azepin-7-yl]acetate (PubChem CID 159095862) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is methyl 2-[(3aR,6R,8aS)-6-(2-methylpropyl)-8-oxo-1,2,3,3a,6,8a-hexahydropyrrolo[2,3-c]azepin-7-yl]acetate.
| Compound Name | methyl 2-[(3aR,6R,8aS)-6-(2-methylpropyl)-8-oxo-1,2,3,3a,6,8a-hexahydropyrrolo[2,3-c]azepin-7-yl]acetate |
|---|---|
| PubChem CID | 159095862 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | methyl 2-[(3aR,6R,8aS)-6-(2-methylpropyl)-8-oxo-1,2,3,3a,6,8a-hexahydropyrrolo[2,3-c]azepin-7-yl]acetate |
| SMILES | COC(=O)CN1C(=O)[C@H]2NCC[C@@H]2C=C[C@H]1CC(C)C |
| InChI | InChI=1S/C15H24N2O3/c1-10(2)8-12-5-4-11-6-7-16-14(11)15(19)17(12)9-13(18)20-3/h4-5,10-12,14,16H,6-9H2,1-3H3/t11-,12-,14-/m0/s1 |
| InChIKey | KCQUGXKVGPVKPA-OBJOEFQTSA-N |
| XLogP | 0.95 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|