C10H15NOS — CID 159097715
2-[(3R,5S)-3,4,5-trimethyloxolan-2-yl]-1,3-thiazole (PubChem CID 159097715) has the molecular formula C10H15NOS and a molecular weight of 197.30 g/mol. Its IUPAC name is 2-[(3R,5S)-3,4,5-trimethyloxolan-2-yl]-1,3-thiazole.
| Compound Name | 2-[(3R,5S)-3,4,5-trimethyloxolan-2-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 159097715 |
| Molecular Formula | C10H15NOS |
| Molecular Weight | 197.30 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | 2-[(3R,5S)-3,4,5-trimethyloxolan-2-yl]-1,3-thiazole |
| SMILES | CC1[C@@H](C)C(c2nccs2)O[C@H]1C |
| InChI | InChI=1S/C10H15NOS/c1-6-7(2)9(12-8(6)3)10-11-4-5-13-10/h4-9H,1-3H3/t6?,7-,8+,9?/m1/s1 |
| InChIKey | KCWMOGTZJLXWMT-VOFUFXJISA-N |
| XLogP | 2.88 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.30 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |