About 2-(2-chloro-3-pyridinyl)acetic acid;2-(2-chloro-3-pyridinyl)acetonitrile
2-(2-chloro-3-pyridinyl)acetic acid;2-(2-chloro-3-pyridinyl)acetonitrile (PubChem CID 159099022) has the molecular formula C14H11Cl2N3O2
and a molecular weight of 324.17 g/mol. Its IUPAC name is 2-(2-chloro-3-pyridinyl)acetic acid;2-(2-chloro-3-pyridinyl)acetonitrile.
Molecular Properties
| Compound Name | 2-(2-chloro-3-pyridinyl)acetic acid;2-(2-chloro-3-pyridinyl)acetonitrile |
| PubChem CID | 159099022 |
| Molecular Formula | C14H11Cl2N3O2 |
| Molecular Weight | 324.17 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | 2-(2-chloro-3-pyridinyl)acetic acid;2-(2-chloro-3-pyridinyl)acetonitrile |
| SMILES | N#CCc1cccnc1Cl.O=C(O)Cc1cccnc1Cl |
| InChI | InChI=1S/C7H5ClN2.C7H6ClNO2/c8-7-6(3-4-9)2-1-5-10-7;8-7-5(4-6(10)11)2-1-3-9-7/h1-2,5H,3H2;1-3H,4H2,(H,10,11) |
| InChIKey | KDAQTRHKAKWUQO-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.17 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-chloro-3-pyridinyl)acetic acid;2-(2-chloro-3-pyridinyl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-chloro-3-pyridinyl)acetic acid;2-(2-chloro-3-pyridinyl)acetonitrile?
The IUPAC name of 2-(2-chloro-3-pyridinyl)acetic acid;2-(2-chloro-3-pyridinyl)acetonitrile (CID 159099022) is 2-(2-chloro-3-pyridinyl)acetic acid;2-(2-chloro-3-pyridinyl)acetonitrile.
What is the SMILES notation for 2-(2-chloro-3-pyridinyl)acetic acid;2-(2-chloro-3-pyridinyl)acetonitrile?
The canonical SMILES for 2-(2-chloro-3-pyridinyl)acetic acid;2-(2-chloro-3-pyridinyl)acetonitrile is N#CCc1cccnc1Cl.O=C(O)Cc1cccnc1Cl.
What is the InChIKey of 2-(2-chloro-3-pyridinyl)acetic acid;2-(2-chloro-3-pyridinyl)acetonitrile?
The InChIKey is KDAQTRHKAKWUQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClN2.C7H6ClNO2/c8-7-6(3-4-9)2-1-5-10-7;8-7-5(4-6(10)11)2-1-3-9-7/h1-2,5H,3H2;1-3H,4H2,(H,10,11).
What are the key properties of 2-(2-chloro-3-pyridinyl)acetic acid;2-(2-chloro-3-pyridinyl)acetonitrile?
2-(2-chloro-3-pyridinyl)acetic acid;2-(2-chloro-3-pyridinyl)acetonitrile has a molecular weight of 324.17 g/mol, XLogP of 3.16, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-chloro-3-pyridinyl)acetic acid;2-(2-chloro-3-pyridinyl)acetonitrile is sourced from PubChem (CID 159099022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).