About 5-benzyl-8-(1H-indol-5-yl)-3-(2-oxobutyl)-11H-benzo[b][1,4]benzodiazepin-6-one
5-benzyl-8-(1H-indol-5-yl)-3-(2-oxobutyl)-11H-benzo[b][1,4]benzodiazepin-6-one (PubChem CID 159099996) has the molecular formula C32H27N3O2
and a molecular weight of 485.59 g/mol. Its IUPAC name is 5-benzyl-8-(1H-indol-5-yl)-3-(2-oxobutyl)-11H-benzo[b][1,4]benzodiazepin-6-one.
Molecular Properties
| Compound Name | 5-benzyl-8-(1H-indol-5-yl)-3-(2-oxobutyl)-11H-benzo[b][1,4]benzodiazepin-6-one |
| PubChem CID | 159099996 |
| Molecular Formula | C32H27N3O2 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | 5-benzyl-8-(1H-indol-5-yl)-3-(2-oxobutyl)-11H-benzo[b][1,4]benzodiazepin-6-one |
| SMILES | CCC(=O)Cc1ccc2c(c1)N(Cc1ccccc1)C(=O)c1cc(-c3ccc4[nH]ccc4c3)ccc1N2 |
| InChI | InChI=1S/C32H27N3O2/c1-2-26(36)16-22-8-11-30-31(17-22)35(20-21-6-4-3-5-7-21)32(37)27-19-24(10-13-29(27)34-30)23-9-12-28-25(18-23)14-15-33-28/h3-15,17-19,33-34H,2,16,20H2,1H3 |
| InChIKey | KZRBULKYQGMQDU-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-benzyl-8-(1H-indol-5-yl)-3-(2-oxobutyl)-11H-benzo[b][1,4]benzodiazepin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-benzyl-8-(1H-indol-5-yl)-3-(2-oxobutyl)-11H-benzo[b][1,4]benzodiazepin-6-one?
The IUPAC name of 5-benzyl-8-(1H-indol-5-yl)-3-(2-oxobutyl)-11H-benzo[b][1,4]benzodiazepin-6-one (CID 159099996) is 5-benzyl-8-(1H-indol-5-yl)-3-(2-oxobutyl)-11H-benzo[b][1,4]benzodiazepin-6-one.
What is the SMILES notation for 5-benzyl-8-(1H-indol-5-yl)-3-(2-oxobutyl)-11H-benzo[b][1,4]benzodiazepin-6-one?
The canonical SMILES for 5-benzyl-8-(1H-indol-5-yl)-3-(2-oxobutyl)-11H-benzo[b][1,4]benzodiazepin-6-one is CCC(=O)Cc1ccc2c(c1)N(Cc1ccccc1)C(=O)c1cc(-c3ccc4[nH]ccc4c3)ccc1N2.
What is the InChIKey of 5-benzyl-8-(1H-indol-5-yl)-3-(2-oxobutyl)-11H-benzo[b][1,4]benzodiazepin-6-one?
The InChIKey is KZRBULKYQGMQDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H27N3O2/c1-2-26(36)16-22-8-11-30-31(17-22)35(20-21-6-4-3-5-7-21)32(37)27-19-24(10-13-29(27)34-30)23-9-12-28-25(18-23)14-15-33-28/h3-15,17-19,33-34H,2,16,20H2,1H3.
What are the key properties of 5-benzyl-8-(1H-indol-5-yl)-3-(2-oxobutyl)-11H-benzo[b][1,4]benzodiazepin-6-one?
5-benzyl-8-(1H-indol-5-yl)-3-(2-oxobutyl)-11H-benzo[b][1,4]benzodiazepin-6-one has a molecular weight of 485.59 g/mol, XLogP of 7.26, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzyl-8-(1H-indol-5-yl)-3-(2-oxobutyl)-11H-benzo[b][1,4]benzodiazepin-6-one is sourced from PubChem (CID 159099996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).