About CID 159100556
CID 159100556 (PubChem CID 159100556) has the molecular formula C73H80B2N5O6Si+
and a molecular weight of 1173.18 g/mol.
Molecular Properties
| Compound Name | CID 159100556 |
| PubChem CID | 159100556 |
| Molecular Formula | C73H80B2N5O6Si+ |
| Molecular Weight | 1173.18 g/mol |
| Exact Mass | 1172.61 |
| IUPAC Name | — |
| SMILES | C=C(C)C(=O)CCCCN(Cc1ccccc1O[B]O)Cc1c2ccccc2c(CN(CCCNC(=O)C(=C)C)Cc2ccccc2O[B]O)c2ccc(-c3ccc(C)c(C4=C5C=CC(=[N+]6CCC6)C=C5[Si](C)(C)c5cc(N6CCC6)ccc54)c3)cc12 |
| InChI | InChI=1S/C73H79B2N5O6Si/c1-49(2)67(81)23-14-15-35-77(45-54-19-8-12-24-68(54)85-74-83)48-66-59-22-11-10-21-58(59)65(47-78(36-16-34-76-73(82)50(3)4)46-55-20-9-13-25-69(55)86-75-84)60-31-28-53(42-64(60)66)52-27-26-51(5)63(41-52)72-61-32-29-56(79-37-17-38-79)43-70(61)87(6,7)71-44-57(30-33-62(71)72)80-39-18-40-80/h8-13,19-22,24-33,41-44,83-84H,1,3,14-18,23,34-40,45-48H2,2,4-7H3/p+1 |
| InChIKey | IGFDDJGTHJAXBA-UHFFFAOYSA-O |
| XLogP | 12.01 |
| TPSA | 117.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 87 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1173.18 |
| LogP ≤ 5 | 12.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze CID 159100556 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159100556?
The IUPAC name of CID 159100556 (CID 159100556) is not available.
What is the SMILES notation for CID 159100556?
The canonical SMILES for CID 159100556 is C=C(C)C(=O)CCCCN(Cc1ccccc1O[B]O)Cc1c2ccccc2c(CN(CCCNC(=O)C(=C)C)Cc2ccccc2O[B]O)c2ccc(-c3ccc(C)c(C4=C5C=CC(=[N+]6CCC6)C=C5[Si](C)(C)c5cc(N6CCC6)ccc54)c3)cc12.
What is the InChIKey of CID 159100556?
The InChIKey is IGFDDJGTHJAXBA-UHFFFAOYSA-O. The full InChI is InChI=1S/C73H79B2N5O6Si/c1-49(2)67(81)23-14-15-35-77(45-54-19-8-12-24-68(54)85-74-83)48-66-59-22-11-10-21-58(59)65(47-78(36-16-34-76-73(82)50(3)4)46-55-20-9-13-25-69(55)86-75-84)60-31-28-53(42-64(60)66)52-27-26-51(5)63(41-52)72-61-32-29-56(79-37-17-38-79)43-70(61)87(6,7)71-44-57(30-33-62(71)72)80-39-18-40-80/h8-13,19-22,24-33,41-44,83-84H,1,3,14-18,23,34-40,45-48H2,2,4-7H3/p+1.
What are the key properties of CID 159100556?
CID 159100556 has a molecular weight of 1173.18 g/mol, XLogP of 12.01, 26 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159100556 is sourced from PubChem (CID 159100556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).