C29H25ClF2N6O — CID 159100603
2-[4-[[9-chloro-7-(2,6-difluorophenyl)-5H-pyrimido[5,4-d][2]benzazepin-2-yl]amino]phenyl]-1,4,5,6-tetrahydropyrimidin-5-ol;methane (PubChem CID 159100603) has the molecular formula C29H25ClF2N6O and a molecular weight of 547.01 g/mol. Its IUPAC name is 2-[4-[[9-chloro-7-(2,6-difluorophenyl)-5H-pyrimido[5,4-d][2]benzazepin-2-yl]amino]phenyl]-1,4,5,6-tetrahydropyrimidin-5-ol;methane.
| Compound Name | 2-[4-[[9-chloro-7-(2,6-difluorophenyl)-5H-pyrimido[5,4-d][2]benzazepin-2-yl]amino]phenyl]-1,4,5,6-tetrahydropyrimidin-5-ol;methane |
|---|---|
| PubChem CID | 159100603 |
| Molecular Formula | C29H25ClF2N6O |
| Molecular Weight | 547.01 g/mol |
| Exact Mass | 546.17 |
| IUPAC Name | 2-[4-[[9-chloro-7-(2,6-difluorophenyl)-5H-pyrimido[5,4-d][2]benzazepin-2-yl]amino]phenyl]-1,4,5,6-tetrahydropyrimidin-5-ol;methane |
| SMILES | C.OC1CN=C(c2ccc(Nc3ncc4c(n3)-c3ccc(Cl)cc3C(c3c(F)cccc3F)=NC4)cc2)NC1 |
| InChI | InChI=1S/C28H21ClF2N6O.CH4/c29-17-6-9-20-21(10-17)26(24-22(30)2-1-3-23(24)31)32-11-16-12-35-28(37-25(16)20)36-18-7-4-15(5-8-18)27-33-13-19(38)14-34-27;/h1-10,12,19,38H,11,13-14H2,(H,33,34)(H,35,36,37);1H4 |
| InChIKey | KDFNROJDZIVPCI-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 94.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.01 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |