C13H9ClF3NO — CID 159101500
3-[4-chloro-3-(trifluoromethyl)phenyl]-5-methyl-1H-pyridin-4-one (PubChem CID 159101500) has the molecular formula C13H9ClF3NO and a molecular weight of 287.67 g/mol. Its IUPAC name is 3-[4-chloro-3-(trifluoromethyl)phenyl]-5-methyl-1H-pyridin-4-one.
| Compound Name | 3-[4-chloro-3-(trifluoromethyl)phenyl]-5-methyl-1H-pyridin-4-one |
|---|---|
| PubChem CID | 159101500 |
| Molecular Formula | C13H9ClF3NO |
| Molecular Weight | 287.67 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | 3-[4-chloro-3-(trifluoromethyl)phenyl]-5-methyl-1H-pyridin-4-one |
| SMILES | Cc1c[nH]cc(-c2ccc(Cl)c(C(F)(F)F)c2)c1=O |
| InChI | InChI=1S/C13H9ClF3NO/c1-7-5-18-6-9(12(7)19)8-2-3-11(14)10(4-8)13(15,16)17/h2-6H,1H3,(H,18,19) |
| InChIKey | KDINTWOBUCLAHN-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.67 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |