About 4-imino-1,3,5-tri(propan-2-yl)imidazolidin-2-one
4-imino-1,3,5-tri(propan-2-yl)imidazolidin-2-one (PubChem CID 159102251) has the molecular formula C12H23N3O
and a molecular weight of 225.34 g/mol. Its IUPAC name is 4-imino-1,3,5-tri(propan-2-yl)imidazolidin-2-one.
Molecular Properties
| Compound Name | 4-imino-1,3,5-tri(propan-2-yl)imidazolidin-2-one |
| PubChem CID | 159102251 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | 4-imino-1,3,5-tri(propan-2-yl)imidazolidin-2-one |
| SMILES | [H]/N=C1/C(C(C)C)N(C(C)C)C(=O)N1C(C)C |
| InChI | InChI=1S/C12H23N3O/c1-7(2)10-11(13)15(9(5)6)12(16)14(10)8(3)4/h7-10,13H,1-6H3/b13-11- |
| InChIKey | FGXXVPNABDHNIL-QBFSEMIESA-N |
| XLogP | 2.54 |
| TPSA | 47.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-imino-1,3,5-tri(propan-2-yl)imidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-imino-1,3,5-tri(propan-2-yl)imidazolidin-2-one?
The IUPAC name of 4-imino-1,3,5-tri(propan-2-yl)imidazolidin-2-one (CID 159102251) is 4-imino-1,3,5-tri(propan-2-yl)imidazolidin-2-one.
What is the SMILES notation for 4-imino-1,3,5-tri(propan-2-yl)imidazolidin-2-one?
The canonical SMILES for 4-imino-1,3,5-tri(propan-2-yl)imidazolidin-2-one is [H]/N=C1/C(C(C)C)N(C(C)C)C(=O)N1C(C)C.
What is the InChIKey of 4-imino-1,3,5-tri(propan-2-yl)imidazolidin-2-one?
The InChIKey is FGXXVPNABDHNIL-QBFSEMIESA-N. The full InChI is InChI=1S/C12H23N3O/c1-7(2)10-11(13)15(9(5)6)12(16)14(10)8(3)4/h7-10,13H,1-6H3/b13-11-.
What are the key properties of 4-imino-1,3,5-tri(propan-2-yl)imidazolidin-2-one?
4-imino-1,3,5-tri(propan-2-yl)imidazolidin-2-one has a molecular weight of 225.34 g/mol, XLogP of 2.54, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-imino-1,3,5-tri(propan-2-yl)imidazolidin-2-one is sourced from PubChem (CID 159102251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).