About CID 159102666
CID 159102666 (PubChem CID 159102666) has the molecular formula C48H52B2P4S2+2
and a molecular weight of 838.60 g/mol.
Molecular Properties
| Compound Name | CID 159102666 |
| PubChem CID | 159102666 |
| Molecular Formula | C48H52B2P4S2+2 |
| Molecular Weight | 838.60 g/mol |
| Exact Mass | 838.26 |
| IUPAC Name | — |
| SMILES | S=P(CC[C@@H]1CCC[P@]1(=S)c1ccccc1)(c1ccccc1)c1ccccc1.[B][P+](CC[C@@H]1CCC[P+]1([B])c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H26B2P2.C24H26P2S2/c25-27(21-11-4-1-5-12-21)19-10-17-24(27)18-20-28(26,22-13-6-2-7-14-22)23-15-8-3-9-16-23;27-25(21-11-4-1-5-12-21)19-10-17-24(25)18-20-26(28,22-13-6-2-7-14-22)23-15-8-3-9-16-23/h2*1-9,11-16,24H,10,17-20H2/q+2;/t24-,27?;24-,25-/m00/s1 |
| InChIKey | GWVIDBSZBQZJJU-SDUZYVNHSA-N |
| XLogP | 10.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 56 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 838.60 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 159102666 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159102666?
The IUPAC name of CID 159102666 (CID 159102666) is not available.
What is the SMILES notation for CID 159102666?
The canonical SMILES for CID 159102666 is S=P(CC[C@@H]1CCC[P@]1(=S)c1ccccc1)(c1ccccc1)c1ccccc1.[B][P+](CC[C@@H]1CCC[P+]1([B])c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of CID 159102666?
The InChIKey is GWVIDBSZBQZJJU-SDUZYVNHSA-N. The full InChI is InChI=1S/C24H26B2P2.C24H26P2S2/c25-27(21-11-4-1-5-12-21)19-10-17-24(27)18-20-28(26,22-13-6-2-7-14-22)23-15-8-3-9-16-23;27-25(21-11-4-1-5-12-21)19-10-17-24(25)18-20-26(28,22-13-6-2-7-14-22)23-15-8-3-9-16-23/h2*1-9,11-16,24H,10,17-20H2/q+2;/t24-,27?;24-,25-/m00/s1.
What are the key properties of CID 159102666?
CID 159102666 has a molecular weight of 838.60 g/mol, XLogP of 10.19, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159102666 is sourced from PubChem (CID 159102666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).