About 2-(1,3-dioxolan-4-ylmethyl)guanidine;sulfuric acid
2-(1,3-dioxolan-4-ylmethyl)guanidine;sulfuric acid (PubChem CID 159103051) has the molecular formula C5H13N3O6S
and a molecular weight of 243.24 g/mol. Its IUPAC name is 2-(1,3-dioxolan-4-ylmethyl)guanidine;sulfuric acid.
Molecular Properties
| Compound Name | 2-(1,3-dioxolan-4-ylmethyl)guanidine;sulfuric acid |
| PubChem CID | 159103051 |
| Molecular Formula | C5H13N3O6S |
| Molecular Weight | 243.24 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 2-(1,3-dioxolan-4-ylmethyl)guanidine;sulfuric acid |
| SMILES | NC(N)=NCC1COCO1.O=S(=O)(O)O |
| InChI | InChI=1S/C5H11N3O2.H2O4S/c6-5(7)8-1-4-2-9-3-10-4;1-5(2,3)4/h4H,1-3H2,(H4,6,7,8);(H2,1,2,3,4) |
| InChIKey | KDNHGCREZWEIPG-UHFFFAOYSA-N |
| XLogP | -2.02 |
| TPSA | 157.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.24 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,3-dioxolan-4-ylmethyl)guanidine;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dioxolan-4-ylmethyl)guanidine;sulfuric acid?
The IUPAC name of 2-(1,3-dioxolan-4-ylmethyl)guanidine;sulfuric acid (CID 159103051) is 2-(1,3-dioxolan-4-ylmethyl)guanidine;sulfuric acid.
What is the SMILES notation for 2-(1,3-dioxolan-4-ylmethyl)guanidine;sulfuric acid?
The canonical SMILES for 2-(1,3-dioxolan-4-ylmethyl)guanidine;sulfuric acid is NC(N)=NCC1COCO1.O=S(=O)(O)O.
What is the InChIKey of 2-(1,3-dioxolan-4-ylmethyl)guanidine;sulfuric acid?
The InChIKey is KDNHGCREZWEIPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N3O2.H2O4S/c6-5(7)8-1-4-2-9-3-10-4;1-5(2,3)4/h4H,1-3H2,(H4,6,7,8);(H2,1,2,3,4).
What are the key properties of 2-(1,3-dioxolan-4-ylmethyl)guanidine;sulfuric acid?
2-(1,3-dioxolan-4-ylmethyl)guanidine;sulfuric acid has a molecular weight of 243.24 g/mol, XLogP of -2.02, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dioxolan-4-ylmethyl)guanidine;sulfuric acid is sourced from PubChem (CID 159103051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).