C20H23F3N2O6S2 — CID 159103055
1H-indole;propane-1-sulfonic acid;N-[2,2,2-trifluoro-1-(4-methylsulfonylphenyl)ethylidene]hydroxylamine (PubChem CID 159103055) has the molecular formula C20H23F3N2O6S2 and a molecular weight of 508.54 g/mol. Its IUPAC name is 1H-indole;propane-1-sulfonic acid;N-[2,2,2-trifluoro-1-(4-methylsulfonylphenyl)ethylidene]hydroxylamine.
| Compound Name | 1H-indole;propane-1-sulfonic acid;N-[2,2,2-trifluoro-1-(4-methylsulfonylphenyl)ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 159103055 |
| Molecular Formula | C20H23F3N2O6S2 |
| Molecular Weight | 508.54 g/mol |
| Exact Mass | 508.09 |
| IUPAC Name | 1H-indole;propane-1-sulfonic acid;N-[2,2,2-trifluoro-1-(4-methylsulfonylphenyl)ethylidene]hydroxylamine |
| SMILES | CCCS(=O)(=O)O.CS(=O)(=O)c1ccc(C(=NO)C(F)(F)F)cc1.c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C9H8F3NO3S.C8H7N.C3H8O3S/c1-17(15,16)7-4-2-6(3-5-7)8(13-14)9(10,11)12;1-2-4-8-7(3-1)5-6-9-8;1-2-3-7(4,5)6/h2-5,14H,1H3;1-6,9H;2-3H2,1H3,(H,4,5,6) |
| InChIKey | KDNHJNLMLLZNPM-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 136.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.54 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|