About 2-methyl-4-(trifluoromethoxy)benzoyl chloride;thionyl dichloride
2-methyl-4-(trifluoromethoxy)benzoyl chloride;thionyl dichloride (PubChem CID 159105640) has the molecular formula C9H6Cl3F3O3S
and a molecular weight of 357.56 g/mol. Its IUPAC name is 2-methyl-4-(trifluoromethoxy)benzoyl chloride;thionyl dichloride.
Molecular Properties
| Compound Name | 2-methyl-4-(trifluoromethoxy)benzoyl chloride;thionyl dichloride |
| PubChem CID | 159105640 |
| Molecular Formula | C9H6Cl3F3O3S |
| Molecular Weight | 357.56 g/mol |
| Exact Mass | 355.91 |
| IUPAC Name | 2-methyl-4-(trifluoromethoxy)benzoyl chloride;thionyl dichloride |
| SMILES | Cc1cc(OC(F)(F)F)ccc1C(=O)Cl.O=S(Cl)Cl |
| InChI | InChI=1S/C9H6ClF3O2.Cl2OS/c1-5-4-6(15-9(11,12)13)2-3-7(5)8(10)14;1-4(2)3/h2-4H,1H3; |
| InChIKey | KDVPPGWKFSGNRW-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.56 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-4-(trifluoromethoxy)benzoyl chloride;thionyl dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-(trifluoromethoxy)benzoyl chloride;thionyl dichloride?
The IUPAC name of 2-methyl-4-(trifluoromethoxy)benzoyl chloride;thionyl dichloride (CID 159105640) is 2-methyl-4-(trifluoromethoxy)benzoyl chloride;thionyl dichloride.
What is the SMILES notation for 2-methyl-4-(trifluoromethoxy)benzoyl chloride;thionyl dichloride?
The canonical SMILES for 2-methyl-4-(trifluoromethoxy)benzoyl chloride;thionyl dichloride is Cc1cc(OC(F)(F)F)ccc1C(=O)Cl.O=S(Cl)Cl.
What is the InChIKey of 2-methyl-4-(trifluoromethoxy)benzoyl chloride;thionyl dichloride?
The InChIKey is KDVPPGWKFSGNRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6ClF3O2.Cl2OS/c1-5-4-6(15-9(11,12)13)2-3-7(5)8(10)14;1-4(2)3/h2-4H,1H3;.
What are the key properties of 2-methyl-4-(trifluoromethoxy)benzoyl chloride;thionyl dichloride?
2-methyl-4-(trifluoromethoxy)benzoyl chloride;thionyl dichloride has a molecular weight of 357.56 g/mol, XLogP of 4.32, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-(trifluoromethoxy)benzoyl chloride;thionyl dichloride is sourced from PubChem (CID 159105640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).