C11H27NO2S — CID 159105698
N,N-di(butan-2-yl)ethanesulfonamide;methane (PubChem CID 159105698) has the molecular formula C11H27NO2S and a molecular weight of 237.41 g/mol. Its IUPAC name is N,N-di(butan-2-yl)ethanesulfonamide;methane.
| Compound Name | N,N-di(butan-2-yl)ethanesulfonamide;methane |
|---|---|
| PubChem CID | 159105698 |
| Molecular Formula | C11H27NO2S |
| Molecular Weight | 237.41 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | N,N-di(butan-2-yl)ethanesulfonamide;methane |
| SMILES | C.CCC(C)N(C(C)CC)S(=O)(=O)CC |
| InChI | InChI=1S/C10H23NO2S.CH4/c1-6-9(4)11(10(5)7-2)14(12,13)8-3;/h9-10H,6-8H2,1-5H3;1H4 |
| InChIKey | KDVVSMQDWSCFLO-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |