About 2-(4-bromo-3-fluoro-N-propan-2-ylanilino)-3-methyl-1H-indole-6-carbonitrile;carbon dioxide
2-(4-bromo-3-fluoro-N-propan-2-ylanilino)-3-methyl-1H-indole-6-carbonitrile;carbon dioxide (PubChem CID 159105800) has the molecular formula C20H17BrFN3O2
and a molecular weight of 430.28 g/mol. Its IUPAC name is 2-(4-bromo-3-fluoro-N-propan-2-ylanilino)-3-methyl-1H-indole-6-carbonitrile;carbon dioxide.
Molecular Properties
| Compound Name | 2-(4-bromo-3-fluoro-N-propan-2-ylanilino)-3-methyl-1H-indole-6-carbonitrile;carbon dioxide |
| PubChem CID | 159105800 |
| Molecular Formula | C20H17BrFN3O2 |
| Molecular Weight | 430.28 g/mol |
| Exact Mass | 429.05 |
| IUPAC Name | 2-(4-bromo-3-fluoro-N-propan-2-ylanilino)-3-methyl-1H-indole-6-carbonitrile;carbon dioxide |
| SMILES | Cc1c(N(c2ccc(Br)c(F)c2)C(C)C)[nH]c2cc(C#N)ccc12.O=C=O |
| InChI | InChI=1S/C19H17BrFN3.CO2/c1-11(2)24(14-5-7-16(20)17(21)9-14)19-12(3)15-6-4-13(10-22)8-18(15)23-19;2-1-3/h4-9,11,23H,1-3H3; |
| InChIKey | KDWFDURTCKUZTA-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.28 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-bromo-3-fluoro-N-propan-2-ylanilino)-3-methyl-1H-indole-6-carbonitrile;carbon dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromo-3-fluoro-N-propan-2-ylanilino)-3-methyl-1H-indole-6-carbonitrile;carbon dioxide?
The IUPAC name of 2-(4-bromo-3-fluoro-N-propan-2-ylanilino)-3-methyl-1H-indole-6-carbonitrile;carbon dioxide (CID 159105800) is 2-(4-bromo-3-fluoro-N-propan-2-ylanilino)-3-methyl-1H-indole-6-carbonitrile;carbon dioxide.
What is the SMILES notation for 2-(4-bromo-3-fluoro-N-propan-2-ylanilino)-3-methyl-1H-indole-6-carbonitrile;carbon dioxide?
The canonical SMILES for 2-(4-bromo-3-fluoro-N-propan-2-ylanilino)-3-methyl-1H-indole-6-carbonitrile;carbon dioxide is Cc1c(N(c2ccc(Br)c(F)c2)C(C)C)[nH]c2cc(C#N)ccc12.O=C=O.
What is the InChIKey of 2-(4-bromo-3-fluoro-N-propan-2-ylanilino)-3-methyl-1H-indole-6-carbonitrile;carbon dioxide?
The InChIKey is KDWFDURTCKUZTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17BrFN3.CO2/c1-11(2)24(14-5-7-16(20)17(21)9-14)19-12(3)15-6-4-13(10-22)8-18(15)23-19;2-1-3/h4-9,11,23H,1-3H3;.
What are the key properties of 2-(4-bromo-3-fluoro-N-propan-2-ylanilino)-3-methyl-1H-indole-6-carbonitrile;carbon dioxide?
2-(4-bromo-3-fluoro-N-propan-2-ylanilino)-3-methyl-1H-indole-6-carbonitrile;carbon dioxide has a molecular weight of 430.28 g/mol, XLogP of 5.21, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromo-3-fluoro-N-propan-2-ylanilino)-3-methyl-1H-indole-6-carbonitrile;carbon dioxide is sourced from PubChem (CID 159105800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).