C29H32N8O3 — CID 159105809
(3R)-3-[2-cyano-4-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]pyrimidin-2-yl]phenoxy]pyrrolidine-1-carboxamide (PubChem CID 159105809) has the molecular formula C29H32N8O3 and a molecular weight of 540.63 g/mol. Its IUPAC name is (3R)-3-[2-cyano-4-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]pyrimidin-2-yl]phenoxy]pyrrolidine-1-carboxamide.
| Compound Name | (3R)-3-[2-cyano-4-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]pyrimidin-2-yl]phenoxy]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 159105809 |
| Molecular Formula | C29H32N8O3 |
| Molecular Weight | 540.63 g/mol |
| Exact Mass | 540.26 |
| IUPAC Name | (3R)-3-[2-cyano-4-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]pyrimidin-2-yl]phenoxy]pyrrolidine-1-carboxamide |
| SMILES | N#Cc1cc(-c2nccc(Nc3ccc(N4CCN(C5COC5)CC4)cc3)n2)ccc1O[C@@H]1CCN(C(N)=O)C1 |
| InChI | InChI=1S/C29H32N8O3/c30-16-21-15-20(1-6-26(21)40-25-8-10-37(17-25)29(31)38)28-32-9-7-27(34-28)33-22-2-4-23(5-3-22)35-11-13-36(14-12-35)24-18-39-19-24/h1-7,9,15,24-25H,8,10-14,17-19H2,(H2,31,38)(H,32,33,34)/t25-/m1/s1 |
| InChIKey | DPYASBIZOJMGGM-RUZDIDTESA-N |
| XLogP | 2.81 |
| TPSA | 132.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.63 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|