C39H39F2N3O10S2 — CID 159105959
1-[3,5-difluoro-4-[2-[2-(2-oxopropoxy)ethoxy]ethoxy]phenyl]-3,4-bis[[4-(morpholine-4-carbonyl)phenyl]sulfanyl]pyrrole-2,5-dione (PubChem CID 159105959) has the molecular formula C39H39F2N3O10S2 and a molecular weight of 811.88 g/mol. Its IUPAC name is 1-[3,5-difluoro-4-[2-[2-(2-oxopropoxy)ethoxy]ethoxy]phenyl]-3,4-bis[[4-(morpholine-4-carbonyl)phenyl]sulfanyl]pyrrole-2,5-dione.
| Compound Name | 1-[3,5-difluoro-4-[2-[2-(2-oxopropoxy)ethoxy]ethoxy]phenyl]-3,4-bis[[4-(morpholine-4-carbonyl)phenyl]sulfanyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 159105959 |
| Molecular Formula | C39H39F2N3O10S2 |
| Molecular Weight | 811.88 g/mol |
| Exact Mass | 811.20 |
| IUPAC Name | 1-[3,5-difluoro-4-[2-[2-(2-oxopropoxy)ethoxy]ethoxy]phenyl]-3,4-bis[[4-(morpholine-4-carbonyl)phenyl]sulfanyl]pyrrole-2,5-dione |
| SMILES | CC(=O)COCCOCCOc1c(F)cc(N2C(=O)C(Sc3ccc(C(=O)N4CCOCC4)cc3)=C(Sc3ccc(C(=O)N4CCOCC4)cc3)C2=O)cc1F |
| InChI | InChI=1S/C39H39F2N3O10S2/c1-25(45)24-53-19-18-52-20-21-54-33-31(40)22-28(23-32(33)41)44-38(48)34(55-29-6-2-26(3-7-29)36(46)42-10-14-50-15-11-42)35(39(44)49)56-30-8-4-27(5-9-30)37(47)43-12-16-51-17-13-43/h2-9,22-23H,10-21,24H2,1H3 |
| InChIKey | QOVYLKBWLSVASL-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 141.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.88 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|