C43H47F2N3O12S2 — CID 159105960
1-[3,5-difluoro-4-[2-[2-[2-[2-(2-oxopropoxy)ethoxy]ethoxy]ethoxy]ethoxy]phenyl]-3,4-bis[[4-(morpholine-4-carbonyl)phenyl]sulfanyl]pyrrole-2,5-dione (PubChem CID 159105960) has the molecular formula C43H47F2N3O12S2 and a molecular weight of 899.99 g/mol. Its IUPAC name is 1-[3,5-difluoro-4-[2-[2-[2-[2-(2-oxopropoxy)ethoxy]ethoxy]ethoxy]ethoxy]phenyl]-3,4-bis[[4-(morpholine-4-carbonyl)phenyl]sulfanyl]pyrrole-2,5-dione.
| Compound Name | 1-[3,5-difluoro-4-[2-[2-[2-[2-(2-oxopropoxy)ethoxy]ethoxy]ethoxy]ethoxy]phenyl]-3,4-bis[[4-(morpholine-4-carbonyl)phenyl]sulfanyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 159105960 |
| Molecular Formula | C43H47F2N3O12S2 |
| Molecular Weight | 899.99 g/mol |
| Exact Mass | 899.26 |
| IUPAC Name | 1-[3,5-difluoro-4-[2-[2-[2-[2-(2-oxopropoxy)ethoxy]ethoxy]ethoxy]ethoxy]phenyl]-3,4-bis[[4-(morpholine-4-carbonyl)phenyl]sulfanyl]pyrrole-2,5-dione |
| SMILES | CC(=O)COCCOCCOCCOCCOc1c(F)cc(N2C(=O)C(Sc3ccc(C(=O)N4CCOCC4)cc3)=C(Sc3ccc(C(=O)N4CCOCC4)cc3)C2=O)cc1F |
| InChI | InChI=1S/C43H47F2N3O12S2/c1-29(49)28-59-23-22-57-19-18-56-20-21-58-24-25-60-37-35(44)26-32(27-36(37)45)48-42(52)38(61-33-6-2-30(3-7-33)40(50)46-10-14-54-15-11-46)39(43(48)53)62-34-8-4-31(5-9-34)41(51)47-12-16-55-17-13-47/h2-9,26-27H,10-25,28H2,1H3 |
| InChIKey | DPACYQSSTVMMAR-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 159.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 899.99 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|