C45H51F2N3O13S2 — CID 159105961
1-[3,5-difluoro-4-[2-[2-[2-[2-[2-(2-oxopropoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]phenyl]-3,4-bis[[4-(morpholine-4-carbonyl)phenyl]sulfanyl]pyrrole-2,5-dione (PubChem CID 159105961) has the molecular formula C45H51F2N3O13S2 and a molecular weight of 944.04 g/mol. Its IUPAC name is 1-[3,5-difluoro-4-[2-[2-[2-[2-[2-(2-oxopropoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]phenyl]-3,4-bis[[4-(morpholine-4-carbonyl)phenyl]sulfanyl]pyrrole-2,5-dione.
| Compound Name | 1-[3,5-difluoro-4-[2-[2-[2-[2-[2-(2-oxopropoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]phenyl]-3,4-bis[[4-(morpholine-4-carbonyl)phenyl]sulfanyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 159105961 |
| Molecular Formula | C45H51F2N3O13S2 |
| Molecular Weight | 944.04 g/mol |
| Exact Mass | 943.28 |
| IUPAC Name | 1-[3,5-difluoro-4-[2-[2-[2-[2-[2-(2-oxopropoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]phenyl]-3,4-bis[[4-(morpholine-4-carbonyl)phenyl]sulfanyl]pyrrole-2,5-dione |
| SMILES | CC(=O)COCCOCCOCCOCCOCCOc1c(F)cc(N2C(=O)C(Sc3ccc(C(=O)N4CCOCC4)cc3)=C(Sc3ccc(C(=O)N4CCOCC4)cc3)C2=O)cc1F |
| InChI | InChI=1S/C45H51F2N3O13S2/c1-31(51)30-62-25-24-60-21-20-58-18-19-59-22-23-61-26-27-63-39-37(46)28-34(29-38(39)47)50-44(54)40(64-35-6-2-32(3-7-35)42(52)48-10-14-56-15-11-48)41(45(50)55)65-36-8-4-33(5-9-36)43(53)49-12-16-57-17-13-49/h2-9,28-29H,10-27,30H2,1H3 |
| InChIKey | YCYNAGRSCPLBFV-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 168.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 944.04 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|