About 5-fluoro-1-hydroxy-3H-2,1-benzoxaborole;[4-fluoro-2-(hydroxymethyl)phenyl]boronic acid
5-fluoro-1-hydroxy-3H-2,1-benzoxaborole;[4-fluoro-2-(hydroxymethyl)phenyl]boronic acid (PubChem CID 159108959) has the molecular formula C14H14B2F2O5
and a molecular weight of 321.88 g/mol. Its IUPAC name is 5-fluoro-1-hydroxy-3H-2,1-benzoxaborole;[4-fluoro-2-(hydroxymethyl)phenyl]boronic acid.
Molecular Properties
| Compound Name | 5-fluoro-1-hydroxy-3H-2,1-benzoxaborole;[4-fluoro-2-(hydroxymethyl)phenyl]boronic acid |
| PubChem CID | 159108959 |
| Molecular Formula | C14H14B2F2O5 |
| Molecular Weight | 321.88 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 5-fluoro-1-hydroxy-3H-2,1-benzoxaborole;[4-fluoro-2-(hydroxymethyl)phenyl]boronic acid |
| SMILES | OB1OCc2cc(F)ccc21.OCc1cc(F)ccc1B(O)O |
| InChI | InChI=1S/C7H8BFO3.C7H6BFO2/c9-6-1-2-7(8(11)12)5(3-6)4-10;9-6-1-2-7-5(3-6)4-11-8(7)10/h1-3,10-12H,4H2;1-3,10H,4H2 |
| InChIKey | KEFWUXONNJMGEA-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.88 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-1-hydroxy-3H-2,1-benzoxaborole;[4-fluoro-2-(hydroxymethyl)phenyl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-1-hydroxy-3H-2,1-benzoxaborole;[4-fluoro-2-(hydroxymethyl)phenyl]boronic acid?
The IUPAC name of 5-fluoro-1-hydroxy-3H-2,1-benzoxaborole;[4-fluoro-2-(hydroxymethyl)phenyl]boronic acid (CID 159108959) is 5-fluoro-1-hydroxy-3H-2,1-benzoxaborole;[4-fluoro-2-(hydroxymethyl)phenyl]boronic acid.
What is the SMILES notation for 5-fluoro-1-hydroxy-3H-2,1-benzoxaborole;[4-fluoro-2-(hydroxymethyl)phenyl]boronic acid?
The canonical SMILES for 5-fluoro-1-hydroxy-3H-2,1-benzoxaborole;[4-fluoro-2-(hydroxymethyl)phenyl]boronic acid is OB1OCc2cc(F)ccc21.OCc1cc(F)ccc1B(O)O.
What is the InChIKey of 5-fluoro-1-hydroxy-3H-2,1-benzoxaborole;[4-fluoro-2-(hydroxymethyl)phenyl]boronic acid?
The InChIKey is KEFWUXONNJMGEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8BFO3.C7H6BFO2/c9-6-1-2-7(8(11)12)5(3-6)4-10;9-6-1-2-7-5(3-6)4-11-8(7)10/h1-3,10-12H,4H2;1-3,10H,4H2.
What are the key properties of 5-fluoro-1-hydroxy-3H-2,1-benzoxaborole;[4-fluoro-2-(hydroxymethyl)phenyl]boronic acid?
5-fluoro-1-hydroxy-3H-2,1-benzoxaborole;[4-fluoro-2-(hydroxymethyl)phenyl]boronic acid has a molecular weight of 321.88 g/mol, XLogP of -0.96, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-1-hydroxy-3H-2,1-benzoxaborole;[4-fluoro-2-(hydroxymethyl)phenyl]boronic acid is sourced from PubChem (CID 159108959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).