About acetamide;imidazolidine-2,4-dione
acetamide;imidazolidine-2,4-dione (PubChem CID 159110028) has the molecular formula C5H9N3O3
and a molecular weight of 159.15 g/mol. Its IUPAC name is acetamide;imidazolidine-2,4-dione.
Molecular Properties
| Compound Name | acetamide;imidazolidine-2,4-dione |
| PubChem CID | 159110028 |
| Molecular Formula | C5H9N3O3 |
| Molecular Weight | 159.15 g/mol |
| Exact Mass | 159.06 |
| IUPAC Name | acetamide;imidazolidine-2,4-dione |
| SMILES | CC(N)=O.O=C1CNC(=O)N1 |
| InChI | InChI=1S/C3H4N2O2.C2H5NO/c6-2-1-4-3(7)5-2;1-2(3)4/h1H2,(H2,4,5,6,7);1H3,(H2,3,4) |
| InChIKey | KEJJAOIXRGLBGD-UHFFFAOYSA-N |
| XLogP | -1.68 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.15 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze acetamide;imidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetamide;imidazolidine-2,4-dione?
The IUPAC name of acetamide;imidazolidine-2,4-dione (CID 159110028) is acetamide;imidazolidine-2,4-dione.
What is the SMILES notation for acetamide;imidazolidine-2,4-dione?
The canonical SMILES for acetamide;imidazolidine-2,4-dione is CC(N)=O.O=C1CNC(=O)N1.
What is the InChIKey of acetamide;imidazolidine-2,4-dione?
The InChIKey is KEJJAOIXRGLBGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4N2O2.C2H5NO/c6-2-1-4-3(7)5-2;1-2(3)4/h1H2,(H2,4,5,6,7);1H3,(H2,3,4).
What are the key properties of acetamide;imidazolidine-2,4-dione?
acetamide;imidazolidine-2,4-dione has a molecular weight of 159.15 g/mol, XLogP of -1.68, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetamide;imidazolidine-2,4-dione is sourced from PubChem (CID 159110028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).