C14H25NO — CID 159110947
1-ethoxy-3-methylbuta-1,3-diene;N-ethyl-3-methylbuta-1,3-dien-1-amine (PubChem CID 159110947) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is 1-ethoxy-3-methylbuta-1,3-diene;N-ethyl-3-methylbuta-1,3-dien-1-amine.
| Compound Name | 1-ethoxy-3-methylbuta-1,3-diene;N-ethyl-3-methylbuta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 159110947 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | 1-ethoxy-3-methylbuta-1,3-diene;N-ethyl-3-methylbuta-1,3-dien-1-amine |
| SMILES | C=C(C)C=CNCC.C=C(C)C=COCC |
| InChI | InChI=1S/C7H13N.C7H12O/c2*1-4-8-6-5-7(2)3/h5-6,8H,2,4H2,1,3H3;5-6H,2,4H2,1,3H3 |
| InChIKey | KEMDCTDQXUQUGQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|