About 5-fluoro-1H-pyrimidine-2,4-dione;10H-phenoxazine
5-fluoro-1H-pyrimidine-2,4-dione;10H-phenoxazine (PubChem CID 159111962) has the molecular formula C16H12FN3O3
and a molecular weight of 313.29 g/mol. Its IUPAC name is 5-fluoro-1H-pyrimidine-2,4-dione;10H-phenoxazine.
Molecular Properties
| Compound Name | 5-fluoro-1H-pyrimidine-2,4-dione;10H-phenoxazine |
| PubChem CID | 159111962 |
| Molecular Formula | C16H12FN3O3 |
| Molecular Weight | 313.29 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 5-fluoro-1H-pyrimidine-2,4-dione;10H-phenoxazine |
| SMILES | O=c1[nH]cc(F)c(=O)[nH]1.c1ccc2c(c1)Nc1ccccc1O2 |
| InChI | InChI=1S/C12H9NO.C4H3FN2O2/c1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11;5-2-1-6-4(9)7-3(2)8/h1-8,13H;1H,(H2,6,7,8,9) |
| InChIKey | KEPNONSTPDJYLB-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 86.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.29 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-fluoro-1H-pyrimidine-2,4-dione;10H-phenoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-1H-pyrimidine-2,4-dione;10H-phenoxazine?
The IUPAC name of 5-fluoro-1H-pyrimidine-2,4-dione;10H-phenoxazine (CID 159111962) is 5-fluoro-1H-pyrimidine-2,4-dione;10H-phenoxazine.
What is the SMILES notation for 5-fluoro-1H-pyrimidine-2,4-dione;10H-phenoxazine?
The canonical SMILES for 5-fluoro-1H-pyrimidine-2,4-dione;10H-phenoxazine is O=c1[nH]cc(F)c(=O)[nH]1.c1ccc2c(c1)Nc1ccccc1O2.
What is the InChIKey of 5-fluoro-1H-pyrimidine-2,4-dione;10H-phenoxazine?
The InChIKey is KEPNONSTPDJYLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO.C4H3FN2O2/c1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11;5-2-1-6-4(9)7-3(2)8/h1-8,13H;1H,(H2,6,7,8,9).
What are the key properties of 5-fluoro-1H-pyrimidine-2,4-dione;10H-phenoxazine?
5-fluoro-1H-pyrimidine-2,4-dione;10H-phenoxazine has a molecular weight of 313.29 g/mol, XLogP of 2.74, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-1H-pyrimidine-2,4-dione;10H-phenoxazine is sourced from PubChem (CID 159111962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).