2-methoxyacetic acid;oxaldehydic acid

C5H8O6 — CID 159112040

IUPAC2-methoxyacetic acid;oxaldehydic acid
SMILESCOCC(=O)O.O=CC(=O)O
InChIInChI=1S/C3H6O3.C2H2O3/c1-6-2-3(4)5;3-1-2(4)5/h2H2,1H3,(H,4,5);1H,(H,4,5)
InChIKeyKEPUCCNRCVHJNM-UHFFFAOYSA-N
MW164.11 g/mol
LogP-1.01
Rot. Bonds3

About 2-methoxyacetic acid;oxaldehydic acid

2-methoxyacetic acid;oxaldehydic acid (PubChem CID 159112040) has the molecular formula C5H8O6 and a molecular weight of 164.11 g/mol. Its IUPAC name is 2-methoxyacetic acid;oxaldehydic acid.

Molecular Properties

Compound Name2-methoxyacetic acid;oxaldehydic acid
PubChem CID159112040
Molecular FormulaC5H8O6
Molecular Weight164.11 g/mol
Exact Mass164.03
IUPAC Name2-methoxyacetic acid;oxaldehydic acid
SMILESCOCC(=O)O.O=CC(=O)O
InChIInChI=1S/C3H6O3.C2H2O3/c1-6-2-3(4)5;3-1-2(4)5/h2H2,1H3,(H,4,5);1H,(H,4,5)
InChIKeyKEPUCCNRCVHJNM-UHFFFAOYSA-N
XLogP-1.01
TPSA100.90 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500164.11
LogP ≤ 5-1.01
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze 2-methoxyacetic acid;oxaldehydic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methoxyacetic acid;oxaldehydic acid?
The IUPAC name of 2-methoxyacetic acid;oxaldehydic acid (CID 159112040) is 2-methoxyacetic acid;oxaldehydic acid.
What is the SMILES notation for 2-methoxyacetic acid;oxaldehydic acid?
The canonical SMILES for 2-methoxyacetic acid;oxaldehydic acid is COCC(=O)O.O=CC(=O)O.
What is the InChIKey of 2-methoxyacetic acid;oxaldehydic acid?
The InChIKey is KEPUCCNRCVHJNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O3.C2H2O3/c1-6-2-3(4)5;3-1-2(4)5/h2H2,1H3,(H,4,5);1H,(H,4,5).
What are the key properties of 2-methoxyacetic acid;oxaldehydic acid?
2-methoxyacetic acid;oxaldehydic acid has a molecular weight of 164.11 g/mol, XLogP of -1.01, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxyacetic acid;oxaldehydic acid is sourced from PubChem (CID 159112040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).