C28H46N6O — CID 159113137
1-[4-(aminomethyl)phenyl]-N,N-dimethylpiperidin-4-amine;azane;4-[4-(dimethylamino)piperidin-1-yl]benzaldehyde (PubChem CID 159113137) has the molecular formula C28H46N6O and a molecular weight of 482.72 g/mol. Its IUPAC name is 1-[4-(aminomethyl)phenyl]-N,N-dimethylpiperidin-4-amine;azane;4-[4-(dimethylamino)piperidin-1-yl]benzaldehyde.
| Compound Name | 1-[4-(aminomethyl)phenyl]-N,N-dimethylpiperidin-4-amine;azane;4-[4-(dimethylamino)piperidin-1-yl]benzaldehyde |
|---|---|
| PubChem CID | 159113137 |
| Molecular Formula | C28H46N6O |
| Molecular Weight | 482.72 g/mol |
| Exact Mass | 482.37 |
| IUPAC Name | 1-[4-(aminomethyl)phenyl]-N,N-dimethylpiperidin-4-amine;azane;4-[4-(dimethylamino)piperidin-1-yl]benzaldehyde |
| SMILES | CN(C)C1CCN(c2ccc(C=O)cc2)CC1.CN(C)C1CCN(c2ccc(CN)cc2)CC1.N |
| InChI | InChI=1S/C14H23N3.C14H20N2O.H3N/c1-16(2)13-7-9-17(10-8-13)14-5-3-12(11-15)4-6-14;1-15(2)13-7-9-16(10-8-13)14-5-3-12(11-17)4-6-14;/h3-6,13H,7-11,15H2,1-2H3;3-6,11,13H,7-10H2,1-2H3;1H3 |
| InChIKey | HIZMYVBEUMSWHE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 91.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.72 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|