About 4-(1,6-dimethylbenzo[cd]indol-1-ium-2-yl)-N,N-dimethylaniline;methane
4-(1,6-dimethylbenzo[cd]indol-1-ium-2-yl)-N,N-dimethylaniline;methane (PubChem CID 159113681) has the molecular formula C22H25N2+
and a molecular weight of 317.46 g/mol. Its IUPAC name is 4-(1,6-dimethylbenzo[cd]indol-1-ium-2-yl)-N,N-dimethylaniline;methane.
Molecular Properties
| Compound Name | 4-(1,6-dimethylbenzo[cd]indol-1-ium-2-yl)-N,N-dimethylaniline;methane |
| PubChem CID | 159113681 |
| Molecular Formula | C22H25N2+ |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | 4-(1,6-dimethylbenzo[cd]indol-1-ium-2-yl)-N,N-dimethylaniline;methane |
| SMILES | C.Cc1ccc2c3c(cccc13)C(c1ccc(N(C)C)cc1)=[N+]2C |
| InChI | InChI=1S/C21H21N2.CH4/c1-14-8-13-19-20-17(14)6-5-7-18(20)21(23(19)4)15-9-11-16(12-10-15)22(2)3;/h5-13H,1-4H3;1H4/q+1; |
| InChIKey | KEURVZACAXWZQA-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(1,6-dimethylbenzo[cd]indol-1-ium-2-yl)-N,N-dimethylaniline;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,6-dimethylbenzo[cd]indol-1-ium-2-yl)-N,N-dimethylaniline;methane?
The IUPAC name of 4-(1,6-dimethylbenzo[cd]indol-1-ium-2-yl)-N,N-dimethylaniline;methane (CID 159113681) is 4-(1,6-dimethylbenzo[cd]indol-1-ium-2-yl)-N,N-dimethylaniline;methane.
What is the SMILES notation for 4-(1,6-dimethylbenzo[cd]indol-1-ium-2-yl)-N,N-dimethylaniline;methane?
The canonical SMILES for 4-(1,6-dimethylbenzo[cd]indol-1-ium-2-yl)-N,N-dimethylaniline;methane is C.Cc1ccc2c3c(cccc13)C(c1ccc(N(C)C)cc1)=[N+]2C.
What is the InChIKey of 4-(1,6-dimethylbenzo[cd]indol-1-ium-2-yl)-N,N-dimethylaniline;methane?
The InChIKey is KEURVZACAXWZQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21N2.CH4/c1-14-8-13-19-20-17(14)6-5-7-18(20)21(23(19)4)15-9-11-16(12-10-15)22(2)3;/h5-13H,1-4H3;1H4/q+1;.
What are the key properties of 4-(1,6-dimethylbenzo[cd]indol-1-ium-2-yl)-N,N-dimethylaniline;methane?
4-(1,6-dimethylbenzo[cd]indol-1-ium-2-yl)-N,N-dimethylaniline;methane has a molecular weight of 317.46 g/mol, XLogP of 4.98, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,6-dimethylbenzo[cd]indol-1-ium-2-yl)-N,N-dimethylaniline;methane is sourced from PubChem (CID 159113681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).