C31H56N2O2+2 — CID 159113758
1-[4-[3-(1-tert-butylpyridin-1-ium-4-yl)propyl]pyridin-1-ium-1-yl]-9,9-dimethyldecane-2,7-diol;methane (PubChem CID 159113758) has the molecular formula C31H56N2O2+2 and a molecular weight of 488.80 g/mol. Its IUPAC name is 1-[4-[3-(1-tert-butylpyridin-1-ium-4-yl)propyl]pyridin-1-ium-1-yl]-9,9-dimethyldecane-2,7-diol;methane.
| Compound Name | 1-[4-[3-(1-tert-butylpyridin-1-ium-4-yl)propyl]pyridin-1-ium-1-yl]-9,9-dimethyldecane-2,7-diol;methane |
|---|---|
| PubChem CID | 159113758 |
| Molecular Formula | C31H56N2O2+2 |
| Molecular Weight | 488.80 g/mol |
| Exact Mass | 488.43 |
| IUPAC Name | 1-[4-[3-(1-tert-butylpyridin-1-ium-4-yl)propyl]pyridin-1-ium-1-yl]-9,9-dimethyldecane-2,7-diol;methane |
| SMILES | C.C.CC(C)(C)CC(O)CCCCC(O)C[n+]1ccc(CCCc2cc[n+](C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C29H48N2O2.2CH4/c1-28(2,3)22-26(32)12-7-8-13-27(33)23-30-18-14-24(15-19-30)10-9-11-25-16-20-31(21-17-25)29(4,5)6;;/h14-21,26-27,32-33H,7-13,22-23H2,1-6H3;2*1H4/q+2;; |
| InChIKey | KEUZPGNKAFOJHY-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 48.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.80 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|