C37H43F2N5O5 — CID 159114169
7-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]-1-isocyano-7-methyloctan-4-one;2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]-2-methylpropan-1-amine;4-isocyanobutanoic acid (PubChem CID 159114169) has the molecular formula C37H43F2N5O5 and a molecular weight of 675.78 g/mol. Its IUPAC name is 7-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]-1-isocyano-7-methyloctan-4-one;2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]-2-methylpropan-1-amine;4-isocyanobutanoic acid.
| Compound Name | 7-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]-1-isocyano-7-methyloctan-4-one;2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]-2-methylpropan-1-amine;4-isocyanobutanoic acid |
|---|---|
| PubChem CID | 159114169 |
| Molecular Formula | C37H43F2N5O5 |
| Molecular Weight | 675.78 g/mol |
| Exact Mass | 675.32 |
| IUPAC Name | 7-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]-1-isocyano-7-methyloctan-4-one;2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]-2-methylpropan-1-amine;4-isocyanobutanoic acid |
| SMILES | CC(C)(CN)c1coc(-c2ccc(F)cc2)n1.[C-]#[N+]CCCC(=O)CCC(C)(C)c1coc(-c2ccc(F)cc2)n1.[C-]#[N+]CCCC(=O)O |
| InChI | InChI=1S/C19H21FN2O2.C13H15FN2O.C5H7NO2/c1-19(2,11-10-16(23)5-4-12-21-3)17-13-24-18(22-17)14-6-8-15(20)9-7-14;1-13(2,8-15)11-7-17-12(16-11)9-3-5-10(14)6-4-9;1-6-4-2-3-5(7)8/h6-9,13H,4-5,10-12H2,1-2H3;3-7H,8,15H2,1-2H3;2-4H2,(H,7,8) |
| InChIKey | KEWIFTMNIDGINW-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 141.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.78 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|