About cyclopropylmethanol;2-(cyclopropylmethoxy)-6-iodo-3-methoxypyridine
cyclopropylmethanol;2-(cyclopropylmethoxy)-6-iodo-3-methoxypyridine (PubChem CID 159114657) has the molecular formula C14H20INO3
and a molecular weight of 377.22 g/mol. Its IUPAC name is cyclopropylmethanol;2-(cyclopropylmethoxy)-6-iodo-3-methoxypyridine.
Molecular Properties
| Compound Name | cyclopropylmethanol;2-(cyclopropylmethoxy)-6-iodo-3-methoxypyridine |
| PubChem CID | 159114657 |
| Molecular Formula | C14H20INO3 |
| Molecular Weight | 377.22 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | cyclopropylmethanol;2-(cyclopropylmethoxy)-6-iodo-3-methoxypyridine |
| SMILES | COc1ccc(I)nc1OCC1CC1.OCC1CC1 |
| InChI | InChI=1S/C10H12INO2.C4H8O/c1-13-8-4-5-9(11)12-10(8)14-6-7-2-3-7;5-3-4-1-2-4/h4-5,7H,2-3,6H2,1H3;4-5H,1-3H2 |
| InChIKey | KEXUUCGSSXOZQG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.22 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze cyclopropylmethanol;2-(cyclopropylmethoxy)-6-iodo-3-methoxypyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropylmethanol;2-(cyclopropylmethoxy)-6-iodo-3-methoxypyridine?
The IUPAC name of cyclopropylmethanol;2-(cyclopropylmethoxy)-6-iodo-3-methoxypyridine (CID 159114657) is cyclopropylmethanol;2-(cyclopropylmethoxy)-6-iodo-3-methoxypyridine.
What is the SMILES notation for cyclopropylmethanol;2-(cyclopropylmethoxy)-6-iodo-3-methoxypyridine?
The canonical SMILES for cyclopropylmethanol;2-(cyclopropylmethoxy)-6-iodo-3-methoxypyridine is COc1ccc(I)nc1OCC1CC1.OCC1CC1.
What is the InChIKey of cyclopropylmethanol;2-(cyclopropylmethoxy)-6-iodo-3-methoxypyridine?
The InChIKey is KEXUUCGSSXOZQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12INO2.C4H8O/c1-13-8-4-5-9(11)12-10(8)14-6-7-2-3-7;5-3-4-1-2-4/h4-5,7H,2-3,6H2,1H3;4-5H,1-3H2.
What are the key properties of cyclopropylmethanol;2-(cyclopropylmethoxy)-6-iodo-3-methoxypyridine?
cyclopropylmethanol;2-(cyclopropylmethoxy)-6-iodo-3-methoxypyridine has a molecular weight of 377.22 g/mol, XLogP of 2.87, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropylmethanol;2-(cyclopropylmethoxy)-6-iodo-3-methoxypyridine is sourced from PubChem (CID 159114657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).