About 2-N-(4-aminocyclohexyl)-6-N-[2-(benzylamino)ethyl]-7H-purine-2,6-diamine;hydrochloride
2-N-(4-aminocyclohexyl)-6-N-[2-(benzylamino)ethyl]-7H-purine-2,6-diamine;hydrochloride (PubChem CID 159115587) has the molecular formula C20H29ClN8
and a molecular weight of 416.96 g/mol. Its IUPAC name is 2-N-(4-aminocyclohexyl)-6-N-[2-(benzylamino)ethyl]-7H-purine-2,6-diamine;hydrochloride.
Molecular Properties
| Compound Name | 2-N-(4-aminocyclohexyl)-6-N-[2-(benzylamino)ethyl]-7H-purine-2,6-diamine;hydrochloride |
| PubChem CID | 159115587 |
| Molecular Formula | C20H29ClN8 |
| Molecular Weight | 416.96 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | 2-N-(4-aminocyclohexyl)-6-N-[2-(benzylamino)ethyl]-7H-purine-2,6-diamine;hydrochloride |
| SMILES | Cl.NC1CCC(Nc2nc(NCCNCc3ccccc3)c3[nH]cnc3n2)CC1 |
| InChI | InChI=1S/C20H28N8.ClH/c21-15-6-8-16(9-7-15)26-20-27-18(17-19(28-20)25-13-24-17)23-11-10-22-12-14-4-2-1-3-5-14;/h1-5,13,15-16,22H,6-12,21H2,(H3,23,24,25,26,27,28);1H |
| InChIKey | NEJOECMZRZQCLE-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.96 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-N-(4-aminocyclohexyl)-6-N-[2-(benzylamino)ethyl]-7H-purine-2,6-diamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-(4-aminocyclohexyl)-6-N-[2-(benzylamino)ethyl]-7H-purine-2,6-diamine;hydrochloride?
The IUPAC name of 2-N-(4-aminocyclohexyl)-6-N-[2-(benzylamino)ethyl]-7H-purine-2,6-diamine;hydrochloride (CID 159115587) is 2-N-(4-aminocyclohexyl)-6-N-[2-(benzylamino)ethyl]-7H-purine-2,6-diamine;hydrochloride.
What is the SMILES notation for 2-N-(4-aminocyclohexyl)-6-N-[2-(benzylamino)ethyl]-7H-purine-2,6-diamine;hydrochloride?
The canonical SMILES for 2-N-(4-aminocyclohexyl)-6-N-[2-(benzylamino)ethyl]-7H-purine-2,6-diamine;hydrochloride is Cl.NC1CCC(Nc2nc(NCCNCc3ccccc3)c3[nH]cnc3n2)CC1.
What is the InChIKey of 2-N-(4-aminocyclohexyl)-6-N-[2-(benzylamino)ethyl]-7H-purine-2,6-diamine;hydrochloride?
The InChIKey is NEJOECMZRZQCLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28N8.ClH/c21-15-6-8-16(9-7-15)26-20-27-18(17-19(28-20)25-13-24-17)23-11-10-22-12-14-4-2-1-3-5-14;/h1-5,13,15-16,22H,6-12,21H2,(H3,23,24,25,26,27,28);1H.
What are the key properties of 2-N-(4-aminocyclohexyl)-6-N-[2-(benzylamino)ethyl]-7H-purine-2,6-diamine;hydrochloride?
2-N-(4-aminocyclohexyl)-6-N-[2-(benzylamino)ethyl]-7H-purine-2,6-diamine;hydrochloride has a molecular weight of 416.96 g/mol, XLogP of 2.66, 8 rotatable bonds, 5 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-(4-aminocyclohexyl)-6-N-[2-(benzylamino)ethyl]-7H-purine-2,6-diamine;hydrochloride is sourced from PubChem (CID 159115587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).