C18H17Cl2N3O2S — CID 159115777
3-[(3,4-dichlorophenyl)methyl]-7-(1-methylidene-1-oxothiolan-3-yl)pyrrolo[2,3-d]pyrimidin-4-one (PubChem CID 159115777) has the molecular formula C18H17Cl2N3O2S and a molecular weight of 410.33 g/mol. Its IUPAC name is 3-[(3,4-dichlorophenyl)methyl]-7-(1-methylidene-1-oxothiolan-3-yl)pyrrolo[2,3-d]pyrimidin-4-one.
| Compound Name | 3-[(3,4-dichlorophenyl)methyl]-7-(1-methylidene-1-oxothiolan-3-yl)pyrrolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 159115777 |
| Molecular Formula | C18H17Cl2N3O2S |
| Molecular Weight | 410.33 g/mol |
| Exact Mass | 409.04 |
| IUPAC Name | 3-[(3,4-dichlorophenyl)methyl]-7-(1-methylidene-1-oxothiolan-3-yl)pyrrolo[2,3-d]pyrimidin-4-one |
| SMILES | C=S1(=O)CCC(n2ccc3c(=O)n(Cc4ccc(Cl)c(Cl)c4)cnc32)C1 |
| InChI | InChI=1S/C18H17Cl2N3O2S/c1-26(25)7-5-13(10-26)23-6-4-14-17(23)21-11-22(18(14)24)9-12-2-3-15(19)16(20)8-12/h2-4,6,8,11,13H,1,5,7,9-10H2 |
| InChIKey | WFVVSZBAXKVBBZ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 56.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.33 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|