C36H50O11 — CID 159116234
dimethyl 2-[(2E,4E,6E)-octa-2,4,6-trienyl]propanedioate;dimethyl 2-[(4E,6E)-octa-1,4,6-trien-3-yl]propanedioate;methyl [(2E,4E,6E)-octa-2,4,6-trienyl] carbonate (PubChem CID 159116234) has the molecular formula C36H50O11 and a molecular weight of 658.79 g/mol. Its IUPAC name is dimethyl 2-[(2E,4E,6E)-octa-2,4,6-trienyl]propanedioate;dimethyl 2-[(4E,6E)-octa-1,4,6-trien-3-yl]propanedioate;methyl [(2E,4E,6E)-octa-2,4,6-trienyl] carbonate.
| Compound Name | dimethyl 2-[(2E,4E,6E)-octa-2,4,6-trienyl]propanedioate;dimethyl 2-[(4E,6E)-octa-1,4,6-trien-3-yl]propanedioate;methyl [(2E,4E,6E)-octa-2,4,6-trienyl] carbonate |
|---|---|
| PubChem CID | 159116234 |
| Molecular Formula | C36H50O11 |
| Molecular Weight | 658.79 g/mol |
| Exact Mass | 658.34 |
| IUPAC Name | dimethyl 2-[(2E,4E,6E)-octa-2,4,6-trienyl]propanedioate;dimethyl 2-[(4E,6E)-octa-1,4,6-trien-3-yl]propanedioate;methyl [(2E,4E,6E)-octa-2,4,6-trienyl] carbonate |
| SMILES | C/C=C/C=C/C=C/CC(C(=O)OC)C(=O)OC.C/C=C/C=C/C=C/COC(=O)OC.C=CC(/C=C/C=C/C)C(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/2C13H18O4.C10H14O3/c1-5-7-8-9-10(6-2)11(12(14)16-3)13(15)17-4;1-4-5-6-7-8-9-10-11(12(14)16-2)13(15)17-3;1-3-4-5-6-7-8-9-13-10(11)12-2/h5-11H,2H2,1,3-4H3;4-9,11H,10H2,1-3H3;3-8H,9H2,1-2H3/b7-5+,9-8+;5-4+,7-6+,9-8+;4-3+,6-5+,8-7+ |
| InChIKey | KFCVAXYGNIWTKM-ZDBUEBJXSA-N |
| XLogP | 6.37 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.79 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|