C9H12Cl2N2O2 — CID 159119621
5-tert-butyl-1,3-dichloro-6-methylidene-1,3-diazinane-2,4-dione (PubChem CID 159119621) has the molecular formula C9H12Cl2N2O2 and a molecular weight of 251.11 g/mol. Its IUPAC name is 5-tert-butyl-1,3-dichloro-6-methylidene-1,3-diazinane-2,4-dione.
| Compound Name | 5-tert-butyl-1,3-dichloro-6-methylidene-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 159119621 |
| Molecular Formula | C9H12Cl2N2O2 |
| Molecular Weight | 251.11 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | 5-tert-butyl-1,3-dichloro-6-methylidene-1,3-diazinane-2,4-dione |
| SMILES | C=C1C(C(C)(C)C)C(=O)N(Cl)C(=O)N1Cl |
| InChI | InChI=1S/C9H12Cl2N2O2/c1-5-6(9(2,3)4)7(14)13(11)8(15)12(5)10/h6H,1H2,2-4H3 |
| InChIKey | MYJTZFBRGMFPNM-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.11 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|