C18H28O8 — CID 159120350
(3aR,5R,6S,6aR)-2,2-dimethyl-5-prop-2-enyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol;(1R,2S,5R,7R)-9,9-dimethyl-3,6,8,10-tetraoxatricyclo[5.3.0.02,5]decane (PubChem CID 159120350) has the molecular formula C18H28O8 and a molecular weight of 372.41 g/mol. Its IUPAC name is (3aR,5R,6S,6aR)-2,2-dimethyl-5-prop-2-enyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol;(1R,2S,5R,7R)-9,9-dimethyl-3,6,8,10-tetraoxatricyclo[5.3.0.02,5]decane.
| Compound Name | (3aR,5R,6S,6aR)-2,2-dimethyl-5-prop-2-enyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol;(1R,2S,5R,7R)-9,9-dimethyl-3,6,8,10-tetraoxatricyclo[5.3.0.02,5]decane |
|---|---|
| PubChem CID | 159120350 |
| Molecular Formula | C18H28O8 |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | (3aR,5R,6S,6aR)-2,2-dimethyl-5-prop-2-enyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol;(1R,2S,5R,7R)-9,9-dimethyl-3,6,8,10-tetraoxatricyclo[5.3.0.02,5]decane |
| SMILES | C=CC[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1O.CC1(C)O[C@H]2O[C@@H]3CO[C@@H]3[C@H]2O1 |
| InChI | InChI=1S/C10H16O4.C8H12O4/c1-4-5-6-7(11)8-9(12-6)14-10(2,3)13-8;1-8(2)11-6-5-4(3-9-5)10-7(6)12-8/h4,6-9,11H,1,5H2,2-3H3;4-7H,3H2,1-2H3/t6-,7+,8-,9-;4-,5+,6-,7-/m11/s1 |
| InChIKey | KFPSGRVCSHFFIQ-FIYSISHVSA-N |
| XLogP | 1.06 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|