C16H16F3N4O5S2- — CID 159120997
5-ethylsulfonyl-6-[3-methyl-6-(trifluoromethyl)imidazo[4,5-c]pyridin-2-yl]pyridin-3-ol;methanesulfinate (PubChem CID 159120997) has the molecular formula C16H16F3N4O5S2- and a molecular weight of 465.46 g/mol. Its IUPAC name is 5-ethylsulfonyl-6-[3-methyl-6-(trifluoromethyl)imidazo[4,5-c]pyridin-2-yl]pyridin-3-ol;methanesulfinate.
| Compound Name | 5-ethylsulfonyl-6-[3-methyl-6-(trifluoromethyl)imidazo[4,5-c]pyridin-2-yl]pyridin-3-ol;methanesulfinate |
|---|---|
| PubChem CID | 159120997 |
| Molecular Formula | C16H16F3N4O5S2- |
| Molecular Weight | 465.46 g/mol |
| Exact Mass | 465.05 |
| IUPAC Name | 5-ethylsulfonyl-6-[3-methyl-6-(trifluoromethyl)imidazo[4,5-c]pyridin-2-yl]pyridin-3-ol;methanesulfinate |
| SMILES | CCS(=O)(=O)c1cc(O)cnc1-c1nc2cc(C(F)(F)F)ncc2n1C.CS(=O)[O-] |
| InChI | InChI=1S/C15H13F3N4O3S.CH4O2S/c1-3-26(24,25)11-4-8(23)6-20-13(11)14-21-9-5-12(15(16,17)18)19-7-10(9)22(14)2;1-4(2)3/h4-7,23H,3H2,1-2H3;1H3,(H,2,3)/p-1 |
| InChIKey | QSFRABCKZVSYPP-UHFFFAOYSA-M |
| XLogP | 2.04 |
| TPSA | 138.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.46 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|