C26H26N2O4 — CID 159121354
1-benzylpyrrole-2-carboxylic acid;ethyl 1-benzylpyrrole-2-carboxylate (PubChem CID 159121354) has the molecular formula C26H26N2O4 and a molecular weight of 430.50 g/mol. Its IUPAC name is 1-benzylpyrrole-2-carboxylic acid;ethyl 1-benzylpyrrole-2-carboxylate.
| Compound Name | 1-benzylpyrrole-2-carboxylic acid;ethyl 1-benzylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 159121354 |
| Molecular Formula | C26H26N2O4 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 1-benzylpyrrole-2-carboxylic acid;ethyl 1-benzylpyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1cccn1Cc1ccccc1.O=C(O)c1cccn1Cc1ccccc1 |
| InChI | InChI=1S/C14H15NO2.C12H11NO2/c1-2-17-14(16)13-9-6-10-15(13)11-12-7-4-3-5-8-12;14-12(15)11-7-4-8-13(11)9-10-5-2-1-3-6-10/h3-10H,2,11H2,1H3;1-8H,9H2,(H,14,15) |
| InChIKey | KFSQHYUWZVIFCI-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 73.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |