About CID 159121889
CID 159121889 (PubChem CID 159121889) has the molecular formula C25H23B63F4NO2S
and a molecular weight of 1158.68 g/mol.
Molecular Properties
| Compound Name | CID 159121889 |
| PubChem CID | 159121889 |
| Molecular Formula | C25H23B63F4NO2S |
| Molecular Weight | 1158.68 g/mol |
| Exact Mass | 1170.72 |
| IUPAC Name | — |
| SMILES | Cc1ccc(S(=O)(=O)N2c3cc(F)ccc3CCC2CCc2ccc(C(F)(F)F)cc2)cc1.[B][B]B([B])B(B([B])[B])B(B(B([B])[B])B([B])[B])B(B(B(B([B])[B])B([B])[B])B(B([B])[B])B([B])[B])B(B(B(B([B])[B])B([B])[B])B(B([B])[B])B([B])[B])B(B(B([B])[B])B([B])[B])B(B([B])[B])B([B])[B] |
| InChI | InChI=1S/C25H23F4NO2S.B63/c1-17-2-14-23(15-3-17)33(31,32)30-22(13-8-19-7-11-21(26)16-24(19)30)12-6-18-4-9-20(10-5-18)25(27,28)29;1-33-49(32)57(48(30)31)61(56(46(26)27)47(28)29)63(60(54(42(18)19)43(20)21)55(44(22)23)45(24)25)62(58(50(34(2)3)35(4)5)51(36(6)7)37(8)9)59(52(38(10)11)39(12)13)53(40(14)15)41(16)17/h2-5,7,9-11,14-16,22H,6,8,12-13H2,1H3; |
| InChIKey | ISYPRIFETCZDMZ-UHFFFAOYSA-N |
| XLogP | -17.69 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 96 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 1158.68 |
| LogP ≤ 5 | -17.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 159121889 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159121889?
The IUPAC name of CID 159121889 (CID 159121889) is not available.
What is the SMILES notation for CID 159121889?
The canonical SMILES for CID 159121889 is Cc1ccc(S(=O)(=O)N2c3cc(F)ccc3CCC2CCc2ccc(C(F)(F)F)cc2)cc1.[B][B]B([B])B(B([B])[B])B(B(B([B])[B])B([B])[B])B(B(B(B([B])[B])B([B])[B])B(B([B])[B])B([B])[B])B(B(B(B([B])[B])B([B])[B])B(B([B])[B])B([B])[B])B(B(B([B])[B])B([B])[B])B(B([B])[B])B([B])[B].
What is the InChIKey of CID 159121889?
The InChIKey is ISYPRIFETCZDMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H23F4NO2S.B63/c1-17-2-14-23(15-3-17)33(31,32)30-22(13-8-19-7-11-21(26)16-24(19)30)12-6-18-4-9-20(10-5-18)25(27,28)29;1-33-49(32)57(48(30)31)61(56(46(26)27)47(28)29)63(60(54(42(18)19)43(20)21)55(44(22)23)45(24)25)62(58(50(34(2)3)35(4)5)51(36(6)7)37(8)9)59(52(38(10)11)39(12)13)53(40(14)15)41(16)17/h2-5,7,9-11,14-16,22H,6,8,12-13H2,1H3;.
What are the key properties of CID 159121889?
CID 159121889 has a molecular weight of 1158.68 g/mol, XLogP of -17.69, 35 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159121889 is sourced from PubChem (CID 159121889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).