About (4-thiopyran-4-ylidenecyclohexa-2,5-dien-1-ylidene)azanium perchlorate
(4-thiopyran-4-ylidenecyclohexa-2,5-dien-1-ylidene)azanium perchlorate (PubChem CID 159122064) has the molecular formula C11H10ClNO4S
and a molecular weight of 287.72 g/mol. Its IUPAC name is (4-thiopyran-4-ylidenecyclohexa-2,5-dien-1-ylidene)azanium perchlorate.
Molecular Properties
| Compound Name | (4-thiopyran-4-ylidenecyclohexa-2,5-dien-1-ylidene)azanium perchlorate |
| PubChem CID | 159122064 |
| Molecular Formula | C11H10ClNO4S |
| Molecular Weight | 287.72 g/mol |
| Exact Mass | 287.00 |
| IUPAC Name | (4-thiopyran-4-ylidenecyclohexa-2,5-dien-1-ylidene)azanium perchlorate |
| SMILES | [NH2+]=C1C=CC(=C2C=CSC=C2)C=C1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C11H9NS.ClHO4/c12-11-3-1-9(2-4-11)10-5-7-13-8-6-10;2-1(3,4)5/h1-8,12H;(H,2,3,4,5) |
| InChIKey | HDOJEJUVBMHXPN-UHFFFAOYSA-N |
| XLogP | -3.37 |
| TPSA | 117.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.72 |
| LogP ≤ 5 | -3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (4-thiopyran-4-ylidenecyclohexa-2,5-dien-1-ylidene)azanium perchlorate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-thiopyran-4-ylidenecyclohexa-2,5-dien-1-ylidene)azanium perchlorate?
The IUPAC name of (4-thiopyran-4-ylidenecyclohexa-2,5-dien-1-ylidene)azanium perchlorate (CID 159122064) is (4-thiopyran-4-ylidenecyclohexa-2,5-dien-1-ylidene)azanium perchlorate.
What is the SMILES notation for (4-thiopyran-4-ylidenecyclohexa-2,5-dien-1-ylidene)azanium perchlorate?
The canonical SMILES for (4-thiopyran-4-ylidenecyclohexa-2,5-dien-1-ylidene)azanium perchlorate is [NH2+]=C1C=CC(=C2C=CSC=C2)C=C1.[O-][Cl+3]([O-])([O-])[O-].
What is the InChIKey of (4-thiopyran-4-ylidenecyclohexa-2,5-dien-1-ylidene)azanium perchlorate?
The InChIKey is HDOJEJUVBMHXPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NS.ClHO4/c12-11-3-1-9(2-4-11)10-5-7-13-8-6-10;2-1(3,4)5/h1-8,12H;(H,2,3,4,5).
What are the key properties of (4-thiopyran-4-ylidenecyclohexa-2,5-dien-1-ylidene)azanium perchlorate?
(4-thiopyran-4-ylidenecyclohexa-2,5-dien-1-ylidene)azanium perchlorate has a molecular weight of 287.72 g/mol, XLogP of -3.37, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-thiopyran-4-ylidenecyclohexa-2,5-dien-1-ylidene)azanium perchlorate is sourced from PubChem (CID 159122064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).