C12H26O3S — CID 159123159
1-(2-tert-butylsulfonylethoxy)-3,3-dimethylbutane (PubChem CID 159123159) has the molecular formula C12H26O3S and a molecular weight of 250.40 g/mol. Its IUPAC name is 1-(2-tert-butylsulfonylethoxy)-3,3-dimethylbutane.
| Compound Name | 1-(2-tert-butylsulfonylethoxy)-3,3-dimethylbutane |
|---|---|
| PubChem CID | 159123159 |
| Molecular Formula | C12H26O3S |
| Molecular Weight | 250.40 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 1-(2-tert-butylsulfonylethoxy)-3,3-dimethylbutane |
| SMILES | CC(C)(C)CCOCCS(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C12H26O3S/c1-11(2,3)7-8-15-9-10-16(13,14)12(4,5)6/h7-10H2,1-6H3 |
| InChIKey | VSCAIISPPSYTPR-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.40 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|