About oxane-2,6-dione;pentanedial
oxane-2,6-dione;pentanedial (PubChem CID 159123357) has the molecular formula C10H14O5
and a molecular weight of 214.22 g/mol. Its IUPAC name is oxane-2,6-dione;pentanedial.
Molecular Properties
| Compound Name | oxane-2,6-dione;pentanedial |
| PubChem CID | 159123357 |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | oxane-2,6-dione;pentanedial |
| SMILES | O=C1CCCC(=O)O1.O=CCCCC=O |
| InChI | InChI=1S/C5H6O3.C5H8O2/c6-4-2-1-3-5(7)8-4;6-4-2-1-3-5-7/h1-3H2;4-5H,1-3H2 |
| InChIKey | KFYYQSIIYOEFFZ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze oxane-2,6-dione;pentanedial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxane-2,6-dione;pentanedial?
The IUPAC name of oxane-2,6-dione;pentanedial (CID 159123357) is oxane-2,6-dione;pentanedial.
What is the SMILES notation for oxane-2,6-dione;pentanedial?
The canonical SMILES for oxane-2,6-dione;pentanedial is O=C1CCCC(=O)O1.O=CCCCC=O.
What is the InChIKey of oxane-2,6-dione;pentanedial?
The InChIKey is KFYYQSIIYOEFFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6O3.C5H8O2/c6-4-2-1-3-5(7)8-4;6-4-2-1-3-5-7/h1-3H2;4-5H,1-3H2.
What are the key properties of oxane-2,6-dione;pentanedial?
oxane-2,6-dione;pentanedial has a molecular weight of 214.22 g/mol, XLogP of 0.79, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for oxane-2,6-dione;pentanedial is sourced from PubChem (CID 159123357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).