C22H34N2O2S — CID 159123488
4-tert-butyl-4-(isocyanomethyl)-1-[[3-(propan-2-ylsulfonylmethyl)phenyl]methyl]piperidine (PubChem CID 159123488) has the molecular formula C22H34N2O2S and a molecular weight of 390.59 g/mol. Its IUPAC name is 4-tert-butyl-4-(isocyanomethyl)-1-[[3-(propan-2-ylsulfonylmethyl)phenyl]methyl]piperidine.
| Compound Name | 4-tert-butyl-4-(isocyanomethyl)-1-[[3-(propan-2-ylsulfonylmethyl)phenyl]methyl]piperidine |
|---|---|
| PubChem CID | 159123488 |
| Molecular Formula | C22H34N2O2S |
| Molecular Weight | 390.59 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | 4-tert-butyl-4-(isocyanomethyl)-1-[[3-(propan-2-ylsulfonylmethyl)phenyl]methyl]piperidine |
| SMILES | [C-]#[N+]CC1(C(C)(C)C)CCN(Cc2cccc(CS(=O)(=O)C(C)C)c2)CC1 |
| InChI | InChI=1S/C22H34N2O2S/c1-18(2)27(25,26)16-20-9-7-8-19(14-20)15-24-12-10-22(11-13-24,17-23-6)21(3,4)5/h7-9,14,18H,10-13,15-17H2,1-5H3 |
| InChIKey | QFERWMZLWJHGCU-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 41.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.59 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|