About tributyl-[5-(1,3-dioxolan-2-yl)thiophen-2-yl]stannane
tributyl-[5-(1,3-dioxolan-2-yl)thiophen-2-yl]stannane (PubChem CID 15912351) has the molecular formula C19H34O2SSn
and a molecular weight of 445.26 g/mol. Its IUPAC name is tributyl-[5-(1,3-dioxolan-2-yl)thiophen-2-yl]stannane.
Molecular Properties
| Compound Name | tributyl-[5-(1,3-dioxolan-2-yl)thiophen-2-yl]stannane |
| PubChem CID | 15912351 |
| Molecular Formula | C19H34O2SSn |
| Molecular Weight | 445.26 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | tributyl-[5-(1,3-dioxolan-2-yl)thiophen-2-yl]stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1ccc(C2OCCO2)s1 |
| InChI | InChI=1S/C7H7O2S.3C4H9.Sn/c1-2-6(10-5-1)7-8-3-4-9-7;3*1-3-4-2;/h1-2,7H,3-4H2;3*1,3-4H2,2H3; |
| InChIKey | LPAWLMVOUBWAHW-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 445.26 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tributyl-[5-(1,3-dioxolan-2-yl)thiophen-2-yl]stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tributyl-[5-(1,3-dioxolan-2-yl)thiophen-2-yl]stannane?
The IUPAC name of tributyl-[5-(1,3-dioxolan-2-yl)thiophen-2-yl]stannane (CID 15912351) is tributyl-[5-(1,3-dioxolan-2-yl)thiophen-2-yl]stannane.
What is the SMILES notation for tributyl-[5-(1,3-dioxolan-2-yl)thiophen-2-yl]stannane?
The canonical SMILES for tributyl-[5-(1,3-dioxolan-2-yl)thiophen-2-yl]stannane is CCCC[Sn](CCCC)(CCCC)c1ccc(C2OCCO2)s1.
What is the InChIKey of tributyl-[5-(1,3-dioxolan-2-yl)thiophen-2-yl]stannane?
The InChIKey is LPAWLMVOUBWAHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7O2S.3C4H9.Sn/c1-2-6(10-5-1)7-8-3-4-9-7;3*1-3-4-2;/h1-2,7H,3-4H2;3*1,3-4H2,2H3;.
What are the key properties of tributyl-[5-(1,3-dioxolan-2-yl)thiophen-2-yl]stannane?
tributyl-[5-(1,3-dioxolan-2-yl)thiophen-2-yl]stannane has a molecular weight of 445.26 g/mol, XLogP of 5.85, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tributyl-[5-(1,3-dioxolan-2-yl)thiophen-2-yl]stannane is sourced from PubChem (CID 15912351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).