C37H42N8 — CID 159123882
3,6-dimethyl-2H-indazole;6-methyl-1H-indazole;1,3,6-trimethylindazole;2,3,6-trimethylindazole (PubChem CID 159123882) has the molecular formula C37H42N8 and a molecular weight of 598.80 g/mol. Its IUPAC name is 3,6-dimethyl-2H-indazole;6-methyl-1H-indazole;1,3,6-trimethylindazole;2,3,6-trimethylindazole.
| Compound Name | 3,6-dimethyl-2H-indazole;6-methyl-1H-indazole;1,3,6-trimethylindazole;2,3,6-trimethylindazole |
|---|---|
| PubChem CID | 159123882 |
| Molecular Formula | C37H42N8 |
| Molecular Weight | 598.80 g/mol |
| Exact Mass | 598.35 |
| IUPAC Name | 3,6-dimethyl-2H-indazole;6-methyl-1H-indazole;1,3,6-trimethylindazole;2,3,6-trimethylindazole |
| SMILES | Cc1ccc2c(C)[nH]nc2c1.Cc1ccc2c(C)n(C)nc2c1.Cc1ccc2c(C)nn(C)c2c1.Cc1ccc2cn[nH]c2c1 |
| InChI | InChI=1S/2C10H12N2.C9H10N2.C8H8N2/c1-7-4-5-9-8(2)12(3)11-10(9)6-7;1-7-4-5-9-8(2)11-12(3)10(9)6-7;1-6-3-4-8-7(2)10-11-9(8)5-6;1-6-2-3-7-5-9-10-8(7)4-6/h2*4-6H,1-3H3;3-5H,1-2H3,(H,10,11);2-5H,1H3,(H,9,10) |
| InChIKey | KGAQUEJLHSZTLW-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 93.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.80 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |