C9H13Cl5Si2 — CID 15912395
trichloro-[dichloro-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silyl]silane (PubChem CID 15912395) has the molecular formula C9H13Cl5Si2 and a molecular weight of 354.64 g/mol. Its IUPAC name is trichloro-[dichloro-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silyl]silane.
| Compound Name | trichloro-[dichloro-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silyl]silane |
|---|---|
| PubChem CID | 15912395 |
| Molecular Formula | C9H13Cl5Si2 |
| Molecular Weight | 354.64 g/mol |
| Exact Mass | 351.90 |
| IUPAC Name | trichloro-[dichloro-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silyl]silane |
| SMILES | CC1=C(C)C([Si](Cl)(Cl)[Si](Cl)(Cl)Cl)C(C)=C1C |
| InChI | InChI=1S/C9H13Cl5Si2/c1-5-6(2)8(4)9(7(5)3)15(10,11)16(12,13)14/h9H,1-4H3 |
| InChIKey | PKJLFOABGTXQNW-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.64 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|